diff -r 4ebc2e2fb97c -r 71c04702a3d5 src/hotspot/share/c1/c1_GraphBuilder.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/src/hotspot/share/c1/c1_GraphBuilder.cpp Tue Sep 12 19:03:39 2017 +0200 @@ -0,0 +1,4379 @@ +/* + * Copyright (c) 1999, 2017, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + * + */ + +#include "precompiled.hpp" +#include "c1/c1_CFGPrinter.hpp" +#include "c1/c1_Canonicalizer.hpp" +#include "c1/c1_Compilation.hpp" +#include "c1/c1_GraphBuilder.hpp" +#include "c1/c1_InstructionPrinter.hpp" +#include "ci/ciCallSite.hpp" +#include "ci/ciField.hpp" +#include "ci/ciKlass.hpp" +#include "ci/ciMemberName.hpp" +#include "compiler/compileBroker.hpp" +#include "interpreter/bytecode.hpp" +#include "memory/resourceArea.hpp" +#include "oops/oop.inline.hpp" +#include "runtime/sharedRuntime.hpp" +#include "runtime/compilationPolicy.hpp" +#include "runtime/vm_version.hpp" +#include "utilities/bitMap.inline.hpp" + +class BlockListBuilder VALUE_OBJ_CLASS_SPEC { + private: + Compilation* _compilation; + IRScope* _scope; + + BlockList _blocks; // internal list of all blocks + BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder + + // fields used by mark_loops + ResourceBitMap _active; // for iteration of control flow graph + ResourceBitMap _visited; // for iteration of control flow graph + intArray _loop_map; // caches the information if a block is contained in a loop + int _next_loop_index; // next free loop number + int _next_block_number; // for reverse postorder numbering of blocks + + // accessors + Compilation* compilation() const { return _compilation; } + IRScope* scope() const { return _scope; } + ciMethod* method() const { return scope()->method(); } + XHandlers* xhandlers() const { return scope()->xhandlers(); } + + // unified bailout support + void bailout(const char* msg) const { compilation()->bailout(msg); } + bool bailed_out() const { return compilation()->bailed_out(); } + + // helper functions + BlockBegin* make_block_at(int bci, BlockBegin* predecessor); + void handle_exceptions(BlockBegin* current, int cur_bci); + void handle_jsr(BlockBegin* current, int sr_bci, int next_bci); + void store_one(BlockBegin* current, int local); + void store_two(BlockBegin* current, int local); + void set_entries(int osr_bci); + void set_leaders(); + + void make_loop_header(BlockBegin* block); + void mark_loops(); + int mark_loops(BlockBegin* b, bool in_subroutine); + + // debugging +#ifndef PRODUCT + void print(); +#endif + + public: + // creation + BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci); + + // accessors for GraphBuilder + BlockList* bci2block() const { return _bci2block; } +}; + + +// Implementation of BlockListBuilder + +BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci) + : _compilation(compilation) + , _scope(scope) + , _blocks(16) + , _bci2block(new BlockList(scope->method()->code_size(), NULL)) + , _next_block_number(0) + , _active() // size not known yet + , _visited() // size not known yet + , _next_loop_index(0) + , _loop_map() // size not known yet +{ + set_entries(osr_bci); + set_leaders(); + CHECK_BAILOUT(); + + mark_loops(); + NOT_PRODUCT(if (PrintInitialBlockList) print()); + +#ifndef PRODUCT + if (PrintCFGToFile) { + stringStream title; + title.print("BlockListBuilder "); + scope->method()->print_name(&title); + CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false); + } +#endif +} + + +void BlockListBuilder::set_entries(int osr_bci) { + // generate start blocks + BlockBegin* std_entry = make_block_at(0, NULL); + if (scope()->caller() == NULL) { + std_entry->set(BlockBegin::std_entry_flag); + } + if (osr_bci != -1) { + BlockBegin* osr_entry = make_block_at(osr_bci, NULL); + osr_entry->set(BlockBegin::osr_entry_flag); + } + + // generate exception entry blocks + XHandlers* list = xhandlers(); + const int n = list->length(); + for (int i = 0; i < n; i++) { + XHandler* h = list->handler_at(i); + BlockBegin* entry = make_block_at(h->handler_bci(), NULL); + entry->set(BlockBegin::exception_entry_flag); + h->set_entry_block(entry); + } +} + + +BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) { + assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer"); + + BlockBegin* block = _bci2block->at(cur_bci); + if (block == NULL) { + block = new BlockBegin(cur_bci); + block->init_stores_to_locals(method()->max_locals()); + _bci2block->at_put(cur_bci, block); + _blocks.append(block); + + assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist"); + } + + if (predecessor != NULL) { + if (block->is_set(BlockBegin::exception_entry_flag)) { + BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block); + } + + predecessor->add_successor(block); + block->increment_total_preds(); + } + + return block; +} + + +inline void BlockListBuilder::store_one(BlockBegin* current, int local) { + current->stores_to_locals().set_bit(local); +} +inline void BlockListBuilder::store_two(BlockBegin* current, int local) { + store_one(current, local); + store_one(current, local + 1); +} + + +void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) { + // Draws edges from a block to its exception handlers + XHandlers* list = xhandlers(); + const int n = list->length(); + + for (int i = 0; i < n; i++) { + XHandler* h = list->handler_at(i); + + if (h->covers(cur_bci)) { + BlockBegin* entry = h->entry_block(); + assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set"); + assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set"); + + // add each exception handler only once + if (!current->is_successor(entry)) { + current->add_successor(entry); + entry->increment_total_preds(); + } + + // stop when reaching catchall + if (h->catch_type() == 0) break; + } + } +} + +void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) { + // start a new block after jsr-bytecode and link this block into cfg + make_block_at(next_bci, current); + + // start a new block at the subroutine entry at mark it with special flag + BlockBegin* sr_block = make_block_at(sr_bci, current); + if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) { + sr_block->set(BlockBegin::subroutine_entry_flag); + } +} + + +void BlockListBuilder::set_leaders() { + bool has_xhandlers = xhandlers()->has_handlers(); + BlockBegin* current = NULL; + + // The information which bci starts a new block simplifies the analysis + // Without it, backward branches could jump to a bci where no block was created + // during bytecode iteration. This would require the creation of a new block at the + // branch target and a modification of the successor lists. + const BitMap& bci_block_start = method()->bci_block_start(); + + ciBytecodeStream s(method()); + while (s.next() != ciBytecodeStream::EOBC()) { + int cur_bci = s.cur_bci(); + + if (bci_block_start.at(cur_bci)) { + current = make_block_at(cur_bci, current); + } + assert(current != NULL, "must have current block"); + + if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) { + handle_exceptions(current, cur_bci); + } + + switch (s.cur_bc()) { + // track stores to local variables for selective creation of phi functions + case Bytecodes::_iinc: store_one(current, s.get_index()); break; + case Bytecodes::_istore: store_one(current, s.get_index()); break; + case Bytecodes::_lstore: store_two(current, s.get_index()); break; + case Bytecodes::_fstore: store_one(current, s.get_index()); break; + case Bytecodes::_dstore: store_two(current, s.get_index()); break; + case Bytecodes::_astore: store_one(current, s.get_index()); break; + case Bytecodes::_istore_0: store_one(current, 0); break; + case Bytecodes::_istore_1: store_one(current, 1); break; + case Bytecodes::_istore_2: store_one(current, 2); break; + case Bytecodes::_istore_3: store_one(current, 3); break; + case Bytecodes::_lstore_0: store_two(current, 0); break; + case Bytecodes::_lstore_1: store_two(current, 1); break; + case Bytecodes::_lstore_2: store_two(current, 2); break; + case Bytecodes::_lstore_3: store_two(current, 3); break; + case Bytecodes::_fstore_0: store_one(current, 0); break; + case Bytecodes::_fstore_1: store_one(current, 1); break; + case Bytecodes::_fstore_2: store_one(current, 2); break; + case Bytecodes::_fstore_3: store_one(current, 3); break; + case Bytecodes::_dstore_0: store_two(current, 0); break; + case Bytecodes::_dstore_1: store_two(current, 1); break; + case Bytecodes::_dstore_2: store_two(current, 2); break; + case Bytecodes::_dstore_3: store_two(current, 3); break; + case Bytecodes::_astore_0: store_one(current, 0); break; + case Bytecodes::_astore_1: store_one(current, 1); break; + case Bytecodes::_astore_2: store_one(current, 2); break; + case Bytecodes::_astore_3: store_one(current, 3); break; + + // track bytecodes that affect the control flow + case Bytecodes::_athrow: // fall through + case Bytecodes::_ret: // fall through + case Bytecodes::_ireturn: // fall through + case Bytecodes::_lreturn: // fall through + case Bytecodes::_freturn: // fall through + case Bytecodes::_dreturn: // fall through + case Bytecodes::_areturn: // fall through + case Bytecodes::_return: + current = NULL; + break; + + case Bytecodes::_ifeq: // fall through + case Bytecodes::_ifne: // fall through + case Bytecodes::_iflt: // fall through + case Bytecodes::_ifge: // fall through + case Bytecodes::_ifgt: // fall through + case Bytecodes::_ifle: // fall through + case Bytecodes::_if_icmpeq: // fall through + case Bytecodes::_if_icmpne: // fall through + case Bytecodes::_if_icmplt: // fall through + case Bytecodes::_if_icmpge: // fall through + case Bytecodes::_if_icmpgt: // fall through + case Bytecodes::_if_icmple: // fall through + case Bytecodes::_if_acmpeq: // fall through + case Bytecodes::_if_acmpne: // fall through + case Bytecodes::_ifnull: // fall through + case Bytecodes::_ifnonnull: + make_block_at(s.next_bci(), current); + make_block_at(s.get_dest(), current); + current = NULL; + break; + + case Bytecodes::_goto: + make_block_at(s.get_dest(), current); + current = NULL; + break; + + case Bytecodes::_goto_w: + make_block_at(s.get_far_dest(), current); + current = NULL; + break; + + case Bytecodes::_jsr: + handle_jsr(current, s.get_dest(), s.next_bci()); + current = NULL; + break; + + case Bytecodes::_jsr_w: + handle_jsr(current, s.get_far_dest(), s.next_bci()); + current = NULL; + break; + + case Bytecodes::_tableswitch: { + // set block for each case + Bytecode_tableswitch sw(&s); + int l = sw.length(); + for (int i = 0; i < l; i++) { + make_block_at(cur_bci + sw.dest_offset_at(i), current); + } + make_block_at(cur_bci + sw.default_offset(), current); + current = NULL; + break; + } + + case Bytecodes::_lookupswitch: { + // set block for each case + Bytecode_lookupswitch sw(&s); + int l = sw.number_of_pairs(); + for (int i = 0; i < l; i++) { + make_block_at(cur_bci + sw.pair_at(i).offset(), current); + } + make_block_at(cur_bci + sw.default_offset(), current); + current = NULL; + break; + } + + default: + break; + } + } +} + + +void BlockListBuilder::mark_loops() { + ResourceMark rm; + + _active.initialize(BlockBegin::number_of_blocks()); + _visited.initialize(BlockBegin::number_of_blocks()); + _loop_map = intArray(BlockBegin::number_of_blocks(), BlockBegin::number_of_blocks(), 0); + _next_loop_index = 0; + _next_block_number = _blocks.length(); + + // recursively iterate the control flow graph + mark_loops(_bci2block->at(0), false); + assert(_next_block_number >= 0, "invalid block numbers"); + + // Remove dangling Resource pointers before the ResourceMark goes out-of-scope. + _active.resize(0); + _visited.resize(0); +} + +void BlockListBuilder::make_loop_header(BlockBegin* block) { + if (block->is_set(BlockBegin::exception_entry_flag)) { + // exception edges may look like loops but don't mark them as such + // since it screws up block ordering. + return; + } + if (!block->is_set(BlockBegin::parser_loop_header_flag)) { + block->set(BlockBegin::parser_loop_header_flag); + + assert(_loop_map.at(block->block_id()) == 0, "must not be set yet"); + assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer"); + _loop_map.at_put(block->block_id(), 1 << _next_loop_index); + if (_next_loop_index < 31) _next_loop_index++; + } else { + // block already marked as loop header + assert(is_power_of_2((unsigned int)_loop_map.at(block->block_id())), "exactly one bit must be set"); + } +} + +int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) { + int block_id = block->block_id(); + + if (_visited.at(block_id)) { + if (_active.at(block_id)) { + // reached block via backward branch + make_loop_header(block); + } + // return cached loop information for this block + return _loop_map.at(block_id); + } + + if (block->is_set(BlockBegin::subroutine_entry_flag)) { + in_subroutine = true; + } + + // set active and visited bits before successors are processed + _visited.set_bit(block_id); + _active.set_bit(block_id); + + intptr_t loop_state = 0; + for (int i = block->number_of_sux() - 1; i >= 0; i--) { + // recursively process all successors + loop_state |= mark_loops(block->sux_at(i), in_subroutine); + } + + // clear active-bit after all successors are processed + _active.clear_bit(block_id); + + // reverse-post-order numbering of all blocks + block->set_depth_first_number(_next_block_number); + _next_block_number--; + + if (loop_state != 0 || in_subroutine ) { + // block is contained at least in one loop, so phi functions are necessary + // phi functions are also necessary for all locals stored in a subroutine + scope()->requires_phi_function().set_union(block->stores_to_locals()); + } + + if (block->is_set(BlockBegin::parser_loop_header_flag)) { + int header_loop_state = _loop_map.at(block_id); + assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set"); + + // If the highest bit is set (i.e. when integer value is negative), the method + // has 32 or more loops. This bit is never cleared because it is used for multiple loops + if (header_loop_state >= 0) { + clear_bits(loop_state, header_loop_state); + } + } + + // cache and return loop information for this block + _loop_map.at_put(block_id, loop_state); + return loop_state; +} + + +#ifndef PRODUCT + +int compare_depth_first(BlockBegin** a, BlockBegin** b) { + return (*a)->depth_first_number() - (*b)->depth_first_number(); +} + +void BlockListBuilder::print() { + tty->print("----- initial block list of BlockListBuilder for method "); + method()->print_short_name(); + tty->cr(); + + // better readability if blocks are sorted in processing order + _blocks.sort(compare_depth_first); + + for (int i = 0; i < _blocks.length(); i++) { + BlockBegin* cur = _blocks.at(i); + tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds()); + + tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " "); + tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " "); + tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " "); + tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " "); + tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " "); + + if (cur->number_of_sux() > 0) { + tty->print(" sux: "); + for (int j = 0; j < cur->number_of_sux(); j++) { + BlockBegin* sux = cur->sux_at(j); + tty->print("B%d ", sux->block_id()); + } + } + tty->cr(); + } +} + +#endif + + +// A simple growable array of Values indexed by ciFields +class FieldBuffer: public CompilationResourceObj { + private: + GrowableArray _values; + + public: + FieldBuffer() {} + + void kill() { + _values.trunc_to(0); + } + + Value at(ciField* field) { + assert(field->holder()->is_loaded(), "must be a loaded field"); + int offset = field->offset(); + if (offset < _values.length()) { + return _values.at(offset); + } else { + return NULL; + } + } + + void at_put(ciField* field, Value value) { + assert(field->holder()->is_loaded(), "must be a loaded field"); + int offset = field->offset(); + _values.at_put_grow(offset, value, NULL); + } + +}; + + +// MemoryBuffer is fairly simple model of the current state of memory. +// It partitions memory into several pieces. The first piece is +// generic memory where little is known about the owner of the memory. +// This is conceptually represented by the tuple which says +// that the field F of object O has value V. This is flattened so +// that F is represented by the offset of the field and the parallel +// arrays _objects and _values are used for O and V. Loads of O.F can +// simply use V. Newly allocated objects are kept in a separate list +// along with a parallel array for each object which represents the +// current value of its fields. Stores of the default value to fields +// which have never been stored to before are eliminated since they +// are redundant. Once newly allocated objects are stored into +// another object or they are passed out of the current compile they +// are treated like generic memory. + +class MemoryBuffer: public CompilationResourceObj { + private: + FieldBuffer _values; + GrowableArray _objects; + GrowableArray _newobjects; + GrowableArray _fields; + + public: + MemoryBuffer() {} + + StoreField* store(StoreField* st) { + if (!EliminateFieldAccess) { + return st; + } + + Value object = st->obj(); + Value value = st->value(); + ciField* field = st->field(); + if (field->holder()->is_loaded()) { + int offset = field->offset(); + int index = _newobjects.find(object); + if (index != -1) { + // newly allocated object with no other stores performed on this field + FieldBuffer* buf = _fields.at(index); + if (buf->at(field) == NULL && is_default_value(value)) { +#ifndef PRODUCT + if (PrintIRDuringConstruction && Verbose) { + tty->print_cr("Eliminated store for object %d:", index); + st->print_line(); + } +#endif + return NULL; + } else { + buf->at_put(field, value); + } + } else { + _objects.at_put_grow(offset, object, NULL); + _values.at_put(field, value); + } + + store_value(value); + } else { + // if we held onto field names we could alias based on names but + // we don't know what's being stored to so kill it all. + kill(); + } + return st; + } + + + // return true if this value correspond to the default value of a field. + bool is_default_value(Value value) { + Constant* con = value->as_Constant(); + if (con) { + switch (con->type()->tag()) { + case intTag: return con->type()->as_IntConstant()->value() == 0; + case longTag: return con->type()->as_LongConstant()->value() == 0; + case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0; + case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0); + case objectTag: return con->type() == objectNull; + default: ShouldNotReachHere(); + } + } + return false; + } + + + // return either the actual value of a load or the load itself + Value load(LoadField* load) { + if (!EliminateFieldAccess) { + return load; + } + + if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) { + // can't skip load since value might get rounded as a side effect + return load; + } + + ciField* field = load->field(); + Value object = load->obj(); + if (field->holder()->is_loaded() && !field->is_volatile()) { + int offset = field->offset(); + Value result = NULL; + int index = _newobjects.find(object); + if (index != -1) { + result = _fields.at(index)->at(field); + } else if (_objects.at_grow(offset, NULL) == object) { + result = _values.at(field); + } + if (result != NULL) { +#ifndef PRODUCT + if (PrintIRDuringConstruction && Verbose) { + tty->print_cr("Eliminated load: "); + load->print_line(); + } +#endif + assert(result->type()->tag() == load->type()->tag(), "wrong types"); + return result; + } + } + return load; + } + + // Record this newly allocated object + void new_instance(NewInstance* object) { + int index = _newobjects.length(); + _newobjects.append(object); + if (_fields.at_grow(index, NULL) == NULL) { + _fields.at_put(index, new FieldBuffer()); + } else { + _fields.at(index)->kill(); + } + } + + void store_value(Value value) { + int index = _newobjects.find(value); + if (index != -1) { + // stored a newly allocated object into another object. + // Assume we've lost track of it as separate slice of memory. + // We could do better by keeping track of whether individual + // fields could alias each other. + _newobjects.remove_at(index); + // pull out the field info and store it at the end up the list + // of field info list to be reused later. + _fields.append(_fields.at(index)); + _fields.remove_at(index); + } + } + + void kill() { + _newobjects.trunc_to(0); + _objects.trunc_to(0); + _values.kill(); + } +}; + + +// Implementation of GraphBuilder's ScopeData + +GraphBuilder::ScopeData::ScopeData(ScopeData* parent) + : _parent(parent) + , _bci2block(NULL) + , _scope(NULL) + , _has_handler(false) + , _stream(NULL) + , _work_list(NULL) + , _parsing_jsr(false) + , _jsr_xhandlers(NULL) + , _caller_stack_size(-1) + , _continuation(NULL) + , _num_returns(0) + , _cleanup_block(NULL) + , _cleanup_return_prev(NULL) + , _cleanup_state(NULL) + , _ignore_return(false) +{ + if (parent != NULL) { + _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f); + } else { + _max_inline_size = MaxInlineSize; + } + if (_max_inline_size < MaxTrivialSize) { + _max_inline_size = MaxTrivialSize; + } +} + + +void GraphBuilder::kill_all() { + if (UseLocalValueNumbering) { + vmap()->kill_all(); + } + _memory->kill(); +} + + +BlockBegin* GraphBuilder::ScopeData::block_at(int bci) { + if (parsing_jsr()) { + // It is necessary to clone all blocks associated with a + // subroutine, including those for exception handlers in the scope + // of the method containing the jsr (because those exception + // handlers may contain ret instructions in some cases). + BlockBegin* block = bci2block()->at(bci); + if (block != NULL && block == parent()->bci2block()->at(bci)) { + BlockBegin* new_block = new BlockBegin(block->bci()); + if (PrintInitialBlockList) { + tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr", + block->block_id(), block->bci(), new_block->block_id()); + } + // copy data from cloned blocked + new_block->set_depth_first_number(block->depth_first_number()); + if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag); + // Preserve certain flags for assertion checking + if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag); + if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag); + + // copy was_visited_flag to allow early detection of bailouts + // if a block that is used in a jsr has already been visited before, + // it is shared between the normal control flow and a subroutine + // BlockBegin::try_merge returns false when the flag is set, this leads + // to a compilation bailout + if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag); + + bci2block()->at_put(bci, new_block); + block = new_block; + } + return block; + } else { + return bci2block()->at(bci); + } +} + + +XHandlers* GraphBuilder::ScopeData::xhandlers() const { + if (_jsr_xhandlers == NULL) { + assert(!parsing_jsr(), ""); + return scope()->xhandlers(); + } + assert(parsing_jsr(), ""); + return _jsr_xhandlers; +} + + +void GraphBuilder::ScopeData::set_scope(IRScope* scope) { + _scope = scope; + bool parent_has_handler = false; + if (parent() != NULL) { + parent_has_handler = parent()->has_handler(); + } + _has_handler = parent_has_handler || scope->xhandlers()->has_handlers(); +} + + +void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block, + Instruction* return_prev, + ValueStack* return_state) { + _cleanup_block = block; + _cleanup_return_prev = return_prev; + _cleanup_state = return_state; +} + + +void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) { + if (_work_list == NULL) { + _work_list = new BlockList(); + } + + if (!block->is_set(BlockBegin::is_on_work_list_flag)) { + // Do not start parsing the continuation block while in a + // sub-scope + if (parsing_jsr()) { + if (block == jsr_continuation()) { + return; + } + } else { + if (block == continuation()) { + return; + } + } + block->set(BlockBegin::is_on_work_list_flag); + _work_list->push(block); + + sort_top_into_worklist(_work_list, block); + } +} + + +void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) { + assert(worklist->top() == top, ""); + // sort block descending into work list + const int dfn = top->depth_first_number(); + assert(dfn != -1, "unknown depth first number"); + int i = worklist->length()-2; + while (i >= 0) { + BlockBegin* b = worklist->at(i); + if (b->depth_first_number() < dfn) { + worklist->at_put(i+1, b); + } else { + break; + } + i --; + } + if (i >= -1) worklist->at_put(i + 1, top); +} + + +BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() { + if (is_work_list_empty()) { + return NULL; + } + return _work_list->pop(); +} + + +bool GraphBuilder::ScopeData::is_work_list_empty() const { + return (_work_list == NULL || _work_list->length() == 0); +} + + +void GraphBuilder::ScopeData::setup_jsr_xhandlers() { + assert(parsing_jsr(), ""); + // clone all the exception handlers from the scope + XHandlers* handlers = new XHandlers(scope()->xhandlers()); + const int n = handlers->length(); + for (int i = 0; i < n; i++) { + // The XHandlers need to be adjusted to dispatch to the cloned + // handler block instead of the default one but the synthetic + // unlocker needs to be handled specially. The synthetic unlocker + // should be left alone since there can be only one and all code + // should dispatch to the same one. + XHandler* h = handlers->handler_at(i); + assert(h->handler_bci() != SynchronizationEntryBCI, "must be real"); + h->set_entry_block(block_at(h->handler_bci())); + } + _jsr_xhandlers = handlers; +} + + +int GraphBuilder::ScopeData::num_returns() { + if (parsing_jsr()) { + return parent()->num_returns(); + } + return _num_returns; +} + + +void GraphBuilder::ScopeData::incr_num_returns() { + if (parsing_jsr()) { + parent()->incr_num_returns(); + } else { + ++_num_returns; + } +} + + +// Implementation of GraphBuilder + +#define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; } + + +void GraphBuilder::load_constant() { + ciConstant con = stream()->get_constant(); + if (con.basic_type() == T_ILLEGAL) { + BAILOUT("could not resolve a constant"); + } else { + ValueType* t = illegalType; + ValueStack* patch_state = NULL; + switch (con.basic_type()) { + case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break; + case T_BYTE : t = new IntConstant (con.as_byte ()); break; + case T_CHAR : t = new IntConstant (con.as_char ()); break; + case T_SHORT : t = new IntConstant (con.as_short ()); break; + case T_INT : t = new IntConstant (con.as_int ()); break; + case T_LONG : t = new LongConstant (con.as_long ()); break; + case T_FLOAT : t = new FloatConstant (con.as_float ()); break; + case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break; + case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break; + case T_OBJECT : + { + ciObject* obj = con.as_object(); + if (!obj->is_loaded() + || (PatchALot && obj->klass() != ciEnv::current()->String_klass())) { + patch_state = copy_state_before(); + t = new ObjectConstant(obj); + } else { + assert(obj->is_instance(), "must be java_mirror of klass"); + t = new InstanceConstant(obj->as_instance()); + } + break; + } + default : ShouldNotReachHere(); + } + Value x; + if (patch_state != NULL) { + x = new Constant(t, patch_state); + } else { + x = new Constant(t); + } + push(t, append(x)); + } +} + + +void GraphBuilder::load_local(ValueType* type, int index) { + Value x = state()->local_at(index); + assert(x != NULL && !x->type()->is_illegal(), "access of illegal local variable"); + push(type, x); +} + + +void GraphBuilder::store_local(ValueType* type, int index) { + Value x = pop(type); + store_local(state(), x, index); +} + + +void GraphBuilder::store_local(ValueStack* state, Value x, int index) { + if (parsing_jsr()) { + // We need to do additional tracking of the location of the return + // address for jsrs since we don't handle arbitrary jsr/ret + // constructs. Here we are figuring out in which circumstances we + // need to bail out. + if (x->type()->is_address()) { + scope_data()->set_jsr_return_address_local(index); + + // Also check parent jsrs (if any) at this time to see whether + // they are using this local. We don't handle skipping over a + // ret. + for (ScopeData* cur_scope_data = scope_data()->parent(); + cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); + cur_scope_data = cur_scope_data->parent()) { + if (cur_scope_data->jsr_return_address_local() == index) { + BAILOUT("subroutine overwrites return address from previous subroutine"); + } + } + } else if (index == scope_data()->jsr_return_address_local()) { + scope_data()->set_jsr_return_address_local(-1); + } + } + + state->store_local(index, round_fp(x)); +} + + +void GraphBuilder::load_indexed(BasicType type) { + // In case of in block code motion in range check elimination + ValueStack* state_before = copy_state_indexed_access(); + compilation()->set_has_access_indexed(true); + Value index = ipop(); + Value array = apop(); + Value length = NULL; + if (CSEArrayLength || + (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || + (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { + length = append(new ArrayLength(array, state_before)); + } + push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, state_before))); +} + + +void GraphBuilder::store_indexed(BasicType type) { + // In case of in block code motion in range check elimination + ValueStack* state_before = copy_state_indexed_access(); + compilation()->set_has_access_indexed(true); + Value value = pop(as_ValueType(type)); + Value index = ipop(); + Value array = apop(); + Value length = NULL; + if (CSEArrayLength || + (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || + (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { + length = append(new ArrayLength(array, state_before)); + } + ciType* array_type = array->declared_type(); + bool check_boolean = false; + if (array_type != NULL) { + if (array_type->is_loaded() && + array_type->as_array_klass()->element_type()->basic_type() == T_BOOLEAN) { + assert(type == T_BYTE, "boolean store uses bastore"); + Value mask = append(new Constant(new IntConstant(1))); + value = append(new LogicOp(Bytecodes::_iand, value, mask)); + } + } else if (type == T_BYTE) { + check_boolean = true; + } + StoreIndexed* result = new StoreIndexed(array, index, length, type, value, state_before, check_boolean); + append(result); + _memory->store_value(value); + + if (type == T_OBJECT && is_profiling()) { + // Note that we'd collect profile data in this method if we wanted it. + compilation()->set_would_profile(true); + + if (profile_checkcasts()) { + result->set_profiled_method(method()); + result->set_profiled_bci(bci()); + result->set_should_profile(true); + } + } +} + + +void GraphBuilder::stack_op(Bytecodes::Code code) { + switch (code) { + case Bytecodes::_pop: + { state()->raw_pop(); + } + break; + case Bytecodes::_pop2: + { state()->raw_pop(); + state()->raw_pop(); + } + break; + case Bytecodes::_dup: + { Value w = state()->raw_pop(); + state()->raw_push(w); + state()->raw_push(w); + } + break; + case Bytecodes::_dup_x1: + { Value w1 = state()->raw_pop(); + Value w2 = state()->raw_pop(); + state()->raw_push(w1); + state()->raw_push(w2); + state()->raw_push(w1); + } + break; + case Bytecodes::_dup_x2: + { Value w1 = state()->raw_pop(); + Value w2 = state()->raw_pop(); + Value w3 = state()->raw_pop(); + state()->raw_push(w1); + state()->raw_push(w3); + state()->raw_push(w2); + state()->raw_push(w1); + } + break; + case Bytecodes::_dup2: + { Value w1 = state()->raw_pop(); + Value w2 = state()->raw_pop(); + state()->raw_push(w2); + state()->raw_push(w1); + state()->raw_push(w2); + state()->raw_push(w1); + } + break; + case Bytecodes::_dup2_x1: + { Value w1 = state()->raw_pop(); + Value w2 = state()->raw_pop(); + Value w3 = state()->raw_pop(); + state()->raw_push(w2); + state()->raw_push(w1); + state()->raw_push(w3); + state()->raw_push(w2); + state()->raw_push(w1); + } + break; + case Bytecodes::_dup2_x2: + { Value w1 = state()->raw_pop(); + Value w2 = state()->raw_pop(); + Value w3 = state()->raw_pop(); + Value w4 = state()->raw_pop(); + state()->raw_push(w2); + state()->raw_push(w1); + state()->raw_push(w4); + state()->raw_push(w3); + state()->raw_push(w2); + state()->raw_push(w1); + } + break; + case Bytecodes::_swap: + { Value w1 = state()->raw_pop(); + Value w2 = state()->raw_pop(); + state()->raw_push(w1); + state()->raw_push(w2); + } + break; + default: + ShouldNotReachHere(); + break; + } +} + + +void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* state_before) { + Value y = pop(type); + Value x = pop(type); + // NOTE: strictfp can be queried from current method since we don't + // inline methods with differing strictfp bits + Value res = new ArithmeticOp(code, x, y, method()->is_strict(), state_before); + // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level + res = append(res); + if (method()->is_strict()) { + res = round_fp(res); + } + push(type, res); +} + + +void GraphBuilder::negate_op(ValueType* type) { + push(type, append(new NegateOp(pop(type)))); +} + + +void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) { + Value s = ipop(); + Value x = pop(type); + // try to simplify + // Note: This code should go into the canonicalizer as soon as it can + // can handle canonicalized forms that contain more than one node. + if (CanonicalizeNodes && code == Bytecodes::_iushr) { + // pattern: x >>> s + IntConstant* s1 = s->type()->as_IntConstant(); + if (s1 != NULL) { + // pattern: x >>> s1, with s1 constant + ShiftOp* l = x->as_ShiftOp(); + if (l != NULL && l->op() == Bytecodes::_ishl) { + // pattern: (a << b) >>> s1 + IntConstant* s0 = l->y()->type()->as_IntConstant(); + if (s0 != NULL) { + // pattern: (a << s0) >>> s1 + const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts + const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts + if (s0c == s1c) { + if (s0c == 0) { + // pattern: (a << 0) >>> 0 => simplify to: a + ipush(l->x()); + } else { + // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant + assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases"); + const int m = (1 << (BitsPerInt - s0c)) - 1; + Value s = append(new Constant(new IntConstant(m))); + ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s))); + } + return; + } + } + } + } + } + // could not simplify + push(type, append(new ShiftOp(code, x, s))); +} + + +void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) { + Value y = pop(type); + Value x = pop(type); + push(type, append(new LogicOp(code, x, y))); +} + + +void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) { + ValueStack* state_before = copy_state_before(); + Value y = pop(type); + Value x = pop(type); + ipush(append(new CompareOp(code, x, y, state_before))); +} + + +void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) { + push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to)))); +} + + +void GraphBuilder::increment() { + int index = stream()->get_index(); + int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]); + load_local(intType, index); + ipush(append(new Constant(new IntConstant(delta)))); + arithmetic_op(intType, Bytecodes::_iadd); + store_local(intType, index); +} + + +void GraphBuilder::_goto(int from_bci, int to_bci) { + Goto *x = new Goto(block_at(to_bci), to_bci <= from_bci); + if (is_profiling()) { + compilation()->set_would_profile(true); + x->set_profiled_bci(bci()); + if (profile_branches()) { + x->set_profiled_method(method()); + x->set_should_profile(true); + } + } + append(x); +} + + +void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) { + BlockBegin* tsux = block_at(stream()->get_dest()); + BlockBegin* fsux = block_at(stream()->next_bci()); + bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci(); + // In case of loop invariant code motion or predicate insertion + // before the body of a loop the state is needed + Instruction *i = append(new If(x, cond, false, y, tsux, fsux, (is_bb || compilation()->is_optimistic()) ? state_before : NULL, is_bb)); + + assert(i->as_Goto() == NULL || + (i->as_Goto()->sux_at(0) == tsux && i->as_Goto()->is_safepoint() == tsux->bci() < stream()->cur_bci()) || + (i->as_Goto()->sux_at(0) == fsux && i->as_Goto()->is_safepoint() == fsux->bci() < stream()->cur_bci()), + "safepoint state of Goto returned by canonicalizer incorrect"); + + if (is_profiling()) { + If* if_node = i->as_If(); + if (if_node != NULL) { + // Note that we'd collect profile data in this method if we wanted it. + compilation()->set_would_profile(true); + // At level 2 we need the proper bci to count backedges + if_node->set_profiled_bci(bci()); + if (profile_branches()) { + // Successors can be rotated by the canonicalizer, check for this case. + if_node->set_profiled_method(method()); + if_node->set_should_profile(true); + if (if_node->tsux() == fsux) { + if_node->set_swapped(true); + } + } + return; + } + + // Check if this If was reduced to Goto. + Goto *goto_node = i->as_Goto(); + if (goto_node != NULL) { + compilation()->set_would_profile(true); + goto_node->set_profiled_bci(bci()); + if (profile_branches()) { + goto_node->set_profiled_method(method()); + goto_node->set_should_profile(true); + // Find out which successor is used. + if (goto_node->default_sux() == tsux) { + goto_node->set_direction(Goto::taken); + } else if (goto_node->default_sux() == fsux) { + goto_node->set_direction(Goto::not_taken); + } else { + ShouldNotReachHere(); + } + } + return; + } + } +} + + +void GraphBuilder::if_zero(ValueType* type, If::Condition cond) { + Value y = append(new Constant(intZero)); + ValueStack* state_before = copy_state_before(); + Value x = ipop(); + if_node(x, cond, y, state_before); +} + + +void GraphBuilder::if_null(ValueType* type, If::Condition cond) { + Value y = append(new Constant(objectNull)); + ValueStack* state_before = copy_state_before(); + Value x = apop(); + if_node(x, cond, y, state_before); +} + + +void GraphBuilder::if_same(ValueType* type, If::Condition cond) { + ValueStack* state_before = copy_state_before(); + Value y = pop(type); + Value x = pop(type); + if_node(x, cond, y, state_before); +} + + +void GraphBuilder::jsr(int dest) { + // We only handle well-formed jsrs (those which are "block-structured"). + // If the bytecodes are strange (jumping out of a jsr block) then we + // might end up trying to re-parse a block containing a jsr which + // has already been activated. Watch for this case and bail out. + for (ScopeData* cur_scope_data = scope_data(); + cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); + cur_scope_data = cur_scope_data->parent()) { + if (cur_scope_data->jsr_entry_bci() == dest) { + BAILOUT("too-complicated jsr/ret structure"); + } + } + + push(addressType, append(new Constant(new AddressConstant(next_bci())))); + if (!try_inline_jsr(dest)) { + return; // bailed out while parsing and inlining subroutine + } +} + + +void GraphBuilder::ret(int local_index) { + if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine"); + + if (local_index != scope_data()->jsr_return_address_local()) { + BAILOUT("can not handle complicated jsr/ret constructs"); + } + + // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation + append(new Goto(scope_data()->jsr_continuation(), false)); +} + + +void GraphBuilder::table_switch() { + Bytecode_tableswitch sw(stream()); + const int l = sw.length(); + if (CanonicalizeNodes && l == 1) { + // total of 2 successors => use If instead of switch + // Note: This code should go into the canonicalizer as soon as it can + // can handle canonicalized forms that contain more than one node. + Value key = append(new Constant(new IntConstant(sw.low_key()))); + BlockBegin* tsux = block_at(bci() + sw.dest_offset_at(0)); + BlockBegin* fsux = block_at(bci() + sw.default_offset()); + bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); + // In case of loop invariant code motion or predicate insertion + // before the body of a loop the state is needed + ValueStack* state_before = copy_state_if_bb(is_bb); + append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); + } else { + // collect successors + BlockList* sux = new BlockList(l + 1, NULL); + int i; + bool has_bb = false; + for (i = 0; i < l; i++) { + sux->at_put(i, block_at(bci() + sw.dest_offset_at(i))); + if (sw.dest_offset_at(i) < 0) has_bb = true; + } + // add default successor + if (sw.default_offset() < 0) has_bb = true; + sux->at_put(i, block_at(bci() + sw.default_offset())); + // In case of loop invariant code motion or predicate insertion + // before the body of a loop the state is needed + ValueStack* state_before = copy_state_if_bb(has_bb); + Instruction* res = append(new TableSwitch(ipop(), sux, sw.low_key(), state_before, has_bb)); +#ifdef ASSERT + if (res->as_Goto()) { + for (i = 0; i < l; i++) { + if (sux->at(i) == res->as_Goto()->sux_at(0)) { + assert(res->as_Goto()->is_safepoint() == sw.dest_offset_at(i) < 0, "safepoint state of Goto returned by canonicalizer incorrect"); + } + } + } +#endif + } +} + + +void GraphBuilder::lookup_switch() { + Bytecode_lookupswitch sw(stream()); + const int l = sw.number_of_pairs(); + if (CanonicalizeNodes && l == 1) { + // total of 2 successors => use If instead of switch + // Note: This code should go into the canonicalizer as soon as it can + // can handle canonicalized forms that contain more than one node. + // simplify to If + LookupswitchPair pair = sw.pair_at(0); + Value key = append(new Constant(new IntConstant(pair.match()))); + BlockBegin* tsux = block_at(bci() + pair.offset()); + BlockBegin* fsux = block_at(bci() + sw.default_offset()); + bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); + // In case of loop invariant code motion or predicate insertion + // before the body of a loop the state is needed + ValueStack* state_before = copy_state_if_bb(is_bb);; + append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); + } else { + // collect successors & keys + BlockList* sux = new BlockList(l + 1, NULL); + intArray* keys = new intArray(l, l, 0); + int i; + bool has_bb = false; + for (i = 0; i < l; i++) { + LookupswitchPair pair = sw.pair_at(i); + if (pair.offset() < 0) has_bb = true; + sux->at_put(i, block_at(bci() + pair.offset())); + keys->at_put(i, pair.match()); + } + // add default successor + if (sw.default_offset() < 0) has_bb = true; + sux->at_put(i, block_at(bci() + sw.default_offset())); + // In case of loop invariant code motion or predicate insertion + // before the body of a loop the state is needed + ValueStack* state_before = copy_state_if_bb(has_bb); + Instruction* res = append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb)); +#ifdef ASSERT + if (res->as_Goto()) { + for (i = 0; i < l; i++) { + if (sux->at(i) == res->as_Goto()->sux_at(0)) { + assert(res->as_Goto()->is_safepoint() == sw.pair_at(i).offset() < 0, "safepoint state of Goto returned by canonicalizer incorrect"); + } + } + } +#endif + } +} + +void GraphBuilder::call_register_finalizer() { + // If the receiver requires finalization then emit code to perform + // the registration on return. + + // Gather some type information about the receiver + Value receiver = state()->local_at(0); + assert(receiver != NULL, "must have a receiver"); + ciType* declared_type = receiver->declared_type(); + ciType* exact_type = receiver->exact_type(); + if (exact_type == NULL && + receiver->as_Local() && + receiver->as_Local()->java_index() == 0) { + ciInstanceKlass* ik = compilation()->method()->holder(); + if (ik->is_final()) { + exact_type = ik; + } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) { + // test class is leaf class + compilation()->dependency_recorder()->assert_leaf_type(ik); + exact_type = ik; + } else { + declared_type = ik; + } + } + + // see if we know statically that registration isn't required + bool needs_check = true; + if (exact_type != NULL) { + needs_check = exact_type->as_instance_klass()->has_finalizer(); + } else if (declared_type != NULL) { + ciInstanceKlass* ik = declared_type->as_instance_klass(); + if (!Dependencies::has_finalizable_subclass(ik)) { + compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik); + needs_check = false; + } + } + + if (needs_check) { + // Perform the registration of finalizable objects. + ValueStack* state_before = copy_state_for_exception(); + load_local(objectType, 0); + append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init, + state()->pop_arguments(1), + true, state_before, true)); + } +} + + +void GraphBuilder::method_return(Value x, bool ignore_return) { + if (RegisterFinalizersAtInit && + method()->intrinsic_id() == vmIntrinsics::_Object_init) { + call_register_finalizer(); + } + + bool need_mem_bar = false; + if (method()->name() == ciSymbol::object_initializer_name() && + (scope()->wrote_final() || (AlwaysSafeConstructors && scope()->wrote_fields()) + || (support_IRIW_for_not_multiple_copy_atomic_cpu && scope()->wrote_volatile()) + )){ + need_mem_bar = true; + } + + BasicType bt = method()->return_type()->basic_type(); + switch (bt) { + case T_BYTE: + { + Value shift = append(new Constant(new IntConstant(24))); + x = append(new ShiftOp(Bytecodes::_ishl, x, shift)); + x = append(new ShiftOp(Bytecodes::_ishr, x, shift)); + break; + } + case T_SHORT: + { + Value shift = append(new Constant(new IntConstant(16))); + x = append(new ShiftOp(Bytecodes::_ishl, x, shift)); + x = append(new ShiftOp(Bytecodes::_ishr, x, shift)); + break; + } + case T_CHAR: + { + Value mask = append(new Constant(new IntConstant(0xFFFF))); + x = append(new LogicOp(Bytecodes::_iand, x, mask)); + break; + } + case T_BOOLEAN: + { + Value mask = append(new Constant(new IntConstant(1))); + x = append(new LogicOp(Bytecodes::_iand, x, mask)); + break; + } + default: + break; + } + + // Check to see whether we are inlining. If so, Return + // instructions become Gotos to the continuation point. + if (continuation() != NULL) { + + int invoke_bci = state()->caller_state()->bci(); + + if (x != NULL && !ignore_return) { + ciMethod* caller = state()->scope()->caller()->method(); + Bytecodes::Code invoke_raw_bc = caller->raw_code_at_bci(invoke_bci); + if (invoke_raw_bc == Bytecodes::_invokehandle || invoke_raw_bc == Bytecodes::_invokedynamic) { + ciType* declared_ret_type = caller->get_declared_signature_at_bci(invoke_bci)->return_type(); + if (declared_ret_type->is_klass() && x->exact_type() == NULL && + x->declared_type() != declared_ret_type && declared_ret_type != compilation()->env()->Object_klass()) { + x = append(new TypeCast(declared_ret_type->as_klass(), x, copy_state_before())); + } + } + } + + assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet"); + + if (compilation()->env()->dtrace_method_probes()) { + // Report exit from inline methods + Values* args = new Values(1); + args->push(append(new Constant(new MethodConstant(method())))); + append(new RuntimeCall(voidType, "dtrace_method_exit", CAST_FROM_FN_PTR(address, SharedRuntime::dtrace_method_exit), args)); + } + + // If the inlined method is synchronized, the monitor must be + // released before we jump to the continuation block. + if (method()->is_synchronized()) { + assert(state()->locks_size() == 1, "receiver must be locked here"); + monitorexit(state()->lock_at(0), SynchronizationEntryBCI); + } + + if (need_mem_bar) { + append(new MemBar(lir_membar_storestore)); + } + + // State at end of inlined method is the state of the caller + // without the method parameters on stack, including the + // return value, if any, of the inlined method on operand stack. + set_state(state()->caller_state()->copy_for_parsing()); + if (x != NULL) { + if (!ignore_return) { + state()->push(x->type(), x); + } + if (profile_return() && x->type()->is_object_kind()) { + ciMethod* caller = state()->scope()->method(); + ciMethodData* md = caller->method_data_or_null(); + ciProfileData* data = md->bci_to_data(invoke_bci); + profile_return_type(x, method(), caller, invoke_bci); + } + } + Goto* goto_callee = new Goto(continuation(), false); + + // See whether this is the first return; if so, store off some + // of the state for later examination + if (num_returns() == 0) { + set_inline_cleanup_info(); + } + + // The current bci() is in the wrong scope, so use the bci() of + // the continuation point. + append_with_bci(goto_callee, scope_data()->continuation()->bci()); + incr_num_returns(); + return; + } + + state()->truncate_stack(0); + if (method()->is_synchronized()) { + // perform the unlocking before exiting the method + Value receiver; + if (!method()->is_static()) { + receiver = _initial_state->local_at(0); + } else { + receiver = append(new Constant(new ClassConstant(method()->holder()))); + } + append_split(new MonitorExit(receiver, state()->unlock())); + } + + if (need_mem_bar) { + append(new MemBar(lir_membar_storestore)); + } + + assert(!ignore_return, "Ignoring return value works only for inlining"); + append(new Return(x)); +} + +Value GraphBuilder::make_constant(ciConstant field_value, ciField* field) { + if (!field_value.is_valid()) return NULL; + + BasicType field_type = field_value.basic_type(); + ValueType* value = as_ValueType(field_value); + + // Attach dimension info to stable arrays. + if (FoldStableValues && + field->is_stable() && field_type == T_ARRAY && !field_value.is_null_or_zero()) { + ciArray* array = field_value.as_object()->as_array(); + jint dimension = field->type()->as_array_klass()->dimension(); + value = new StableArrayConstant(array, dimension); + } + + switch (field_type) { + case T_ARRAY: + case T_OBJECT: + if (field_value.as_object()->should_be_constant()) { + return new Constant(value); + } + return NULL; // Not a constant. + default: + return new Constant(value); + } +} + +void GraphBuilder::access_field(Bytecodes::Code code) { + bool will_link; + ciField* field = stream()->get_field(will_link); + ciInstanceKlass* holder = field->holder(); + BasicType field_type = field->type()->basic_type(); + ValueType* type = as_ValueType(field_type); + // call will_link again to determine if the field is valid. + const bool needs_patching = !holder->is_loaded() || + !field->will_link(method(), code) || + PatchALot; + + ValueStack* state_before = NULL; + if (!holder->is_initialized() || needs_patching) { + // save state before instruction for debug info when + // deoptimization happens during patching + state_before = copy_state_before(); + } + + Value obj = NULL; + if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) { + if (state_before != NULL) { + // build a patching constant + obj = new Constant(new InstanceConstant(holder->java_mirror()), state_before); + } else { + obj = new Constant(new InstanceConstant(holder->java_mirror())); + } + } + + if (field->is_final() && (code == Bytecodes::_putfield)) { + scope()->set_wrote_final(); + } + + if (code == Bytecodes::_putfield) { + scope()->set_wrote_fields(); + if (field->is_volatile()) { + scope()->set_wrote_volatile(); + } + } + + const int offset = !needs_patching ? field->offset() : -1; + switch (code) { + case Bytecodes::_getstatic: { + // check for compile-time constants, i.e., initialized static final fields + Value constant = NULL; + if (field->is_static_constant() && !PatchALot) { + ciConstant field_value = field->constant_value(); + assert(!field->is_stable() || !field_value.is_null_or_zero(), + "stable static w/ default value shouldn't be a constant"); + constant = make_constant(field_value, field); + } + if (constant != NULL) { + push(type, append(constant)); + } else { + if (state_before == NULL) { + state_before = copy_state_for_exception(); + } + push(type, append(new LoadField(append(obj), offset, field, true, + state_before, needs_patching))); + } + break; + } + case Bytecodes::_putstatic: { + Value val = pop(type); + if (state_before == NULL) { + state_before = copy_state_for_exception(); + } + if (field->type()->basic_type() == T_BOOLEAN) { + Value mask = append(new Constant(new IntConstant(1))); + val = append(new LogicOp(Bytecodes::_iand, val, mask)); + } + append(new StoreField(append(obj), offset, field, val, true, state_before, needs_patching)); + break; + } + case Bytecodes::_getfield: { + // Check for compile-time constants, i.e., trusted final non-static fields. + Value constant = NULL; + obj = apop(); + ObjectType* obj_type = obj->type()->as_ObjectType(); + if (field->is_constant() && obj_type->is_constant() && !PatchALot) { + ciObject* const_oop = obj_type->constant_value(); + if (!const_oop->is_null_object() && const_oop->is_loaded()) { + ciConstant field_value = field->constant_value_of(const_oop); + if (field_value.is_valid()) { + constant = make_constant(field_value, field); + // For CallSite objects add a dependency for invalidation of the optimization. + if (field->is_call_site_target()) { + ciCallSite* call_site = const_oop->as_call_site(); + if (!call_site->is_constant_call_site()) { + ciMethodHandle* target = field_value.as_object()->as_method_handle(); + dependency_recorder()->assert_call_site_target_value(call_site, target); + } + } + } + } + } + if (constant != NULL) { + push(type, append(constant)); + } else { + if (state_before == NULL) { + state_before = copy_state_for_exception(); + } + LoadField* load = new LoadField(obj, offset, field, false, state_before, needs_patching); + Value replacement = !needs_patching ? _memory->load(load) : load; + if (replacement != load) { + assert(replacement->is_linked() || !replacement->can_be_linked(), "should already by linked"); + push(type, replacement); + } else { + push(type, append(load)); + } + } + break; + } + case Bytecodes::_putfield: { + Value val = pop(type); + obj = apop(); + if (state_before == NULL) { + state_before = copy_state_for_exception(); + } + if (field->type()->basic_type() == T_BOOLEAN) { + Value mask = append(new Constant(new IntConstant(1))); + val = append(new LogicOp(Bytecodes::_iand, val, mask)); + } + StoreField* store = new StoreField(obj, offset, field, val, false, state_before, needs_patching); + if (!needs_patching) store = _memory->store(store); + if (store != NULL) { + append(store); + } + break; + } + default: + ShouldNotReachHere(); + break; + } +} + + +Dependencies* GraphBuilder::dependency_recorder() const { + assert(DeoptC1, "need debug information"); + return compilation()->dependency_recorder(); +} + +// How many arguments do we want to profile? +Values* GraphBuilder::args_list_for_profiling(ciMethod* target, int& start, bool may_have_receiver) { + int n = 0; + bool has_receiver = may_have_receiver && Bytecodes::has_receiver(method()->java_code_at_bci(bci())); + start = has_receiver ? 1 : 0; + if (profile_arguments()) { + ciProfileData* data = method()->method_data()->bci_to_data(bci()); + if (data != NULL && (data->is_CallTypeData() || data->is_VirtualCallTypeData())) { + n = data->is_CallTypeData() ? data->as_CallTypeData()->number_of_arguments() : data->as_VirtualCallTypeData()->number_of_arguments(); + } + } + // If we are inlining then we need to collect arguments to profile parameters for the target + if (profile_parameters() && target != NULL) { + if (target->method_data() != NULL && target->method_data()->parameters_type_data() != NULL) { + // The receiver is profiled on method entry so it's included in + // the number of parameters but here we're only interested in + // actual arguments. + n = MAX2(n, target->method_data()->parameters_type_data()->number_of_parameters() - start); + } + } + if (n > 0) { + return new Values(n); + } + return NULL; +} + +void GraphBuilder::check_args_for_profiling(Values* obj_args, int expected) { +#ifdef ASSERT + bool ignored_will_link; + ciSignature* declared_signature = NULL; + ciMethod* real_target = method()->get_method_at_bci(bci(), ignored_will_link, &declared_signature); + assert(expected == obj_args->max_length() || real_target->is_method_handle_intrinsic(), "missed on arg?"); +#endif +} + +// Collect arguments that we want to profile in a list +Values* GraphBuilder::collect_args_for_profiling(Values* args, ciMethod* target, bool may_have_receiver) { + int start = 0; + Values* obj_args = args_list_for_profiling(target, start, may_have_receiver); + if (obj_args == NULL) { + return NULL; + } + int s = obj_args->max_length(); + // if called through method handle invoke, some arguments may have been popped + for (int i = start, j = 0; j < s && i < args->length(); i++) { + if (args->at(i)->type()->is_object_kind()) { + obj_args->push(args->at(i)); + j++; + } + } + check_args_for_profiling(obj_args, s); + return obj_args; +} + + +void GraphBuilder::invoke(Bytecodes::Code code) { + bool will_link; + ciSignature* declared_signature = NULL; + ciMethod* target = stream()->get_method(will_link, &declared_signature); + ciKlass* holder = stream()->get_declared_method_holder(); + const Bytecodes::Code bc_raw = stream()->cur_bc_raw(); + assert(declared_signature != NULL, "cannot be null"); + assert(will_link == target->is_loaded(), ""); + + ciInstanceKlass* klass = target->holder(); + assert(!target->is_loaded() || klass->is_loaded(), "loaded target must imply loaded klass"); + + // check if CHA possible: if so, change the code to invoke_special + ciInstanceKlass* calling_klass = method()->holder(); + ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder); + ciInstanceKlass* actual_recv = callee_holder; + + CompileLog* log = compilation()->log(); + if (log != NULL) + log->elem("call method='%d' instr='%s'", + log->identify(target), + Bytecodes::name(code)); + + // invoke-special-super + if (bc_raw == Bytecodes::_invokespecial && !target->is_object_initializer()) { + ciInstanceKlass* sender_klass = + calling_klass->is_anonymous() ? calling_klass->host_klass() : + calling_klass; + if (sender_klass->is_interface()) { + int index = state()->stack_size() - (target->arg_size_no_receiver() + 1); + Value receiver = state()->stack_at(index); + CheckCast* c = new CheckCast(sender_klass, receiver, copy_state_before()); + c->set_invokespecial_receiver_check(); + state()->stack_at_put(index, append_split(c)); + } + } + + // Some methods are obviously bindable without any type checks so + // convert them directly to an invokespecial or invokestatic. + if (target->is_loaded() && !target->is_abstract() && target->can_be_statically_bound()) { + switch (bc_raw) { + case Bytecodes::_invokevirtual: + code = Bytecodes::_invokespecial; + break; + case Bytecodes::_invokehandle: + code = target->is_static() ? Bytecodes::_invokestatic : Bytecodes::_invokespecial; + break; + default: + break; + } + } else { + if (bc_raw == Bytecodes::_invokehandle) { + assert(!will_link, "should come here only for unlinked call"); + code = Bytecodes::_invokespecial; + } + } + + // Push appendix argument (MethodType, CallSite, etc.), if one. + bool patch_for_appendix = false; + int patching_appendix_arg = 0; + if (Bytecodes::has_optional_appendix(bc_raw) && (!will_link || PatchALot)) { + Value arg = append(new Constant(new ObjectConstant(compilation()->env()->unloaded_ciinstance()), copy_state_before())); + apush(arg); + patch_for_appendix = true; + patching_appendix_arg = (will_link && stream()->has_appendix()) ? 0 : 1; + } else if (stream()->has_appendix()) { + ciObject* appendix = stream()->get_appendix(); + Value arg = append(new Constant(new ObjectConstant(appendix))); + apush(arg); + } + + ciMethod* cha_monomorphic_target = NULL; + ciMethod* exact_target = NULL; + Value better_receiver = NULL; + if (UseCHA && DeoptC1 && target->is_loaded() && + !(// %%% FIXME: Are both of these relevant? + target->is_method_handle_intrinsic() || + target->is_compiled_lambda_form()) && + !patch_for_appendix) { + Value receiver = NULL; + ciInstanceKlass* receiver_klass = NULL; + bool type_is_exact = false; + // try to find a precise receiver type + if (will_link && !target->is_static()) { + int index = state()->stack_size() - (target->arg_size_no_receiver() + 1); + receiver = state()->stack_at(index); + ciType* type = receiver->exact_type(); + if (type != NULL && type->is_loaded() && + type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { + receiver_klass = (ciInstanceKlass*) type; + type_is_exact = true; + } + if (type == NULL) { + type = receiver->declared_type(); + if (type != NULL && type->is_loaded() && + type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { + receiver_klass = (ciInstanceKlass*) type; + if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) { + // Insert a dependency on this type since + // find_monomorphic_target may assume it's already done. + dependency_recorder()->assert_leaf_type(receiver_klass); + type_is_exact = true; + } + } + } + } + if (receiver_klass != NULL && type_is_exact && + receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) { + // If we have the exact receiver type we can bind directly to + // the method to call. + exact_target = target->resolve_invoke(calling_klass, receiver_klass); + if (exact_target != NULL) { + target = exact_target; + code = Bytecodes::_invokespecial; + } + } + if (receiver_klass != NULL && + receiver_klass->is_subtype_of(actual_recv) && + actual_recv->is_initialized()) { + actual_recv = receiver_klass; + } + + if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) || + (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) { + // Use CHA on the receiver to select a more precise method. + cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv); + } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) { + // if there is only one implementor of this interface then we + // may be able bind this invoke directly to the implementing + // klass but we need both a dependence on the single interface + // and on the method we bind to. Additionally since all we know + // about the receiver type is the it's supposed to implement the + // interface we have to insert a check that it's the class we + // expect. Interface types are not checked by the verifier so + // they are roughly equivalent to Object. + ciInstanceKlass* singleton = NULL; + if (target->holder()->nof_implementors() == 1) { + singleton = target->holder()->implementor(); + assert(singleton != NULL && singleton != target->holder(), + "just checking"); + + assert(holder->is_interface(), "invokeinterface to non interface?"); + ciInstanceKlass* decl_interface = (ciInstanceKlass*)holder; + // the number of implementors for decl_interface is less or + // equal to the number of implementors for target->holder() so + // if number of implementors of target->holder() == 1 then + // number of implementors for decl_interface is 0 or 1. If + // it's 0 then no class implements decl_interface and there's + // no point in inlining. + if (!holder->is_loaded() || decl_interface->nof_implementors() != 1 || decl_interface->has_nonstatic_concrete_methods()) { + singleton = NULL; + } + } + if (singleton) { + cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton); + if (cha_monomorphic_target != NULL) { + // If CHA is able to bind this invoke then update the class + // to match that class, otherwise klass will refer to the + // interface. + klass = cha_monomorphic_target->holder(); + actual_recv = target->holder(); + + // insert a check it's really the expected class. + CheckCast* c = new CheckCast(klass, receiver, copy_state_for_exception()); + c->set_incompatible_class_change_check(); + c->set_direct_compare(klass->is_final()); + // pass the result of the checkcast so that the compiler has + // more accurate type info in the inlinee + better_receiver = append_split(c); + } + } + } + } + + if (cha_monomorphic_target != NULL) { + if (cha_monomorphic_target->is_abstract()) { + // Do not optimize for abstract methods + cha_monomorphic_target = NULL; + } + } + + if (cha_monomorphic_target != NULL) { + if (!(target->is_final_method())) { + // If we inlined because CHA revealed only a single target method, + // then we are dependent on that target method not getting overridden + // by dynamic class loading. Be sure to test the "static" receiver + // dest_method here, as opposed to the actual receiver, which may + // falsely lead us to believe that the receiver is final or private. + dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target); + } + code = Bytecodes::_invokespecial; + } + + // check if we could do inlining + if (!PatchALot && Inline && target->is_loaded() && + (klass->is_initialized() || (klass->is_interface() && target->holder()->is_initialized())) + && !patch_for_appendix) { + // callee is known => check if we have static binding + if (code == Bytecodes::_invokestatic || + code == Bytecodes::_invokespecial || + (code == Bytecodes::_invokevirtual && target->is_final_method()) || + code == Bytecodes::_invokedynamic) { + ciMethod* inline_target = (cha_monomorphic_target != NULL) ? cha_monomorphic_target : target; + // static binding => check if callee is ok + bool success = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL), false, code, better_receiver); + + CHECK_BAILOUT(); + clear_inline_bailout(); + + if (success) { + // Register dependence if JVMTI has either breakpoint + // setting or hotswapping of methods capabilities since they may + // cause deoptimization. + if (compilation()->env()->jvmti_can_hotswap_or_post_breakpoint()) { + dependency_recorder()->assert_evol_method(inline_target); + } + return; + } + } else { + print_inlining(target, "no static binding", /*success*/ false); + } + } else { + print_inlining(target, "not inlineable", /*success*/ false); + } + + // If we attempted an inline which did not succeed because of a + // bailout during construction of the callee graph, the entire + // compilation has to be aborted. This is fairly rare and currently + // seems to only occur for jasm-generated classes which contain + // jsr/ret pairs which are not associated with finally clauses and + // do not have exception handlers in the containing method, and are + // therefore not caught early enough to abort the inlining without + // corrupting the graph. (We currently bail out with a non-empty + // stack at a ret in these situations.) + CHECK_BAILOUT(); + + // inlining not successful => standard invoke + ValueType* result_type = as_ValueType(declared_signature->return_type()); + ValueStack* state_before = copy_state_exhandling(); + + // The bytecode (code) might change in this method so we are checking this very late. + const bool has_receiver = + code == Bytecodes::_invokespecial || + code == Bytecodes::_invokevirtual || + code == Bytecodes::_invokeinterface; + Values* args = state()->pop_arguments(target->arg_size_no_receiver() + patching_appendix_arg); + Value recv = has_receiver ? apop() : NULL; + int vtable_index = Method::invalid_vtable_index; + +#ifdef SPARC + // Currently only supported on Sparc. + // The UseInlineCaches only controls dispatch to invokevirtuals for + // loaded classes which we weren't able to statically bind. + if (!UseInlineCaches && target->is_loaded() && code == Bytecodes::_invokevirtual + && !target->can_be_statically_bound()) { + // Find a vtable index if one is available + // For arrays, callee_holder is Object. Resolving the call with + // Object would allow an illegal call to finalize() on an + // array. We use holder instead: illegal calls to finalize() won't + // be compiled as vtable calls (IC call resolution will catch the + // illegal call) and the few legal calls on array types won't be + // either. + vtable_index = target->resolve_vtable_index(calling_klass, holder); + } +#endif + + // A null check is required here (when there is a receiver) for any of the following cases + // - invokespecial, always need a null check. + // - invokevirtual, when the target is final and loaded. Calls to final targets will become optimized + // and require null checking. If the target is loaded a null check is emitted here. + // If the target isn't loaded the null check must happen after the call resolution. We achieve that + // by using the target methods unverified entry point (see CompiledIC::compute_monomorphic_entry). + // (The JVM specification requires that LinkageError must be thrown before a NPE. An unloaded target may + // potentially fail, and can't have the null check before the resolution.) + // - A call that will be profiled. (But we can't add a null check when the target is unloaded, by the same + // reason as above, so calls with a receiver to unloaded targets can't be profiled.) + // + // Normal invokevirtual will perform the null check during lookup + + bool need_null_check = (code == Bytecodes::_invokespecial) || + (target->is_loaded() && (target->is_final_method() || (is_profiling() && profile_calls()))); + + if (need_null_check) { + if (recv != NULL) { + null_check(recv); + } + + if (is_profiling()) { + // Note that we'd collect profile data in this method if we wanted it. + compilation()->set_would_profile(true); + + if (profile_calls()) { + assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set"); + ciKlass* target_klass = NULL; + if (cha_monomorphic_target != NULL) { + target_klass = cha_monomorphic_target->holder(); + } else if (exact_target != NULL) { + target_klass = exact_target->holder(); + } + profile_call(target, recv, target_klass, collect_args_for_profiling(args, NULL, false), false); + } + } + } + + Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target, state_before); + // push result + append_split(result); + + if (result_type != voidType) { + if (method()->is_strict()) { + push(result_type, round_fp(result)); + } else { + push(result_type, result); + } + } + if (profile_return() && result_type->is_object_kind()) { + profile_return_type(result, target); + } +} + + +void GraphBuilder::new_instance(int klass_index) { + ValueStack* state_before = copy_state_exhandling(); + bool will_link; + ciKlass* klass = stream()->get_klass(will_link); + assert(klass->is_instance_klass(), "must be an instance klass"); + NewInstance* new_instance = new NewInstance(klass->as_instance_klass(), state_before, stream()->is_unresolved_klass()); + _memory->new_instance(new_instance); + apush(append_split(new_instance)); +} + + +void GraphBuilder::new_type_array() { + ValueStack* state_before = copy_state_exhandling(); + apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index(), state_before))); +} + + +void GraphBuilder::new_object_array() { + bool will_link; + ciKlass* klass = stream()->get_klass(will_link); + ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_exhandling(); + NewArray* n = new NewObjectArray(klass, ipop(), state_before); + apush(append_split(n)); +} + + +bool GraphBuilder::direct_compare(ciKlass* k) { + if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) { + ciInstanceKlass* ik = k->as_instance_klass(); + if (ik->is_final()) { + return true; + } else { + if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) { + // test class is leaf class + dependency_recorder()->assert_leaf_type(ik); + return true; + } + } + } + return false; +} + + +void GraphBuilder::check_cast(int klass_index) { + bool will_link; + ciKlass* klass = stream()->get_klass(will_link); + ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_for_exception(); + CheckCast* c = new CheckCast(klass, apop(), state_before); + apush(append_split(c)); + c->set_direct_compare(direct_compare(klass)); + + if (is_profiling()) { + // Note that we'd collect profile data in this method if we wanted it. + compilation()->set_would_profile(true); + + if (profile_checkcasts()) { + c->set_profiled_method(method()); + c->set_profiled_bci(bci()); + c->set_should_profile(true); + } + } +} + + +void GraphBuilder::instance_of(int klass_index) { + bool will_link; + ciKlass* klass = stream()->get_klass(will_link); + ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_exhandling(); + InstanceOf* i = new InstanceOf(klass, apop(), state_before); + ipush(append_split(i)); + i->set_direct_compare(direct_compare(klass)); + + if (is_profiling()) { + // Note that we'd collect profile data in this method if we wanted it. + compilation()->set_would_profile(true); + + if (profile_checkcasts()) { + i->set_profiled_method(method()); + i->set_profiled_bci(bci()); + i->set_should_profile(true); + } + } +} + + +void GraphBuilder::monitorenter(Value x, int bci) { + // save state before locking in case of deoptimization after a NullPointerException + ValueStack* state_before = copy_state_for_exception_with_bci(bci); + append_with_bci(new MonitorEnter(x, state()->lock(x), state_before), bci); + kill_all(); +} + + +void GraphBuilder::monitorexit(Value x, int bci) { + append_with_bci(new MonitorExit(x, state()->unlock()), bci); + kill_all(); +} + + +void GraphBuilder::new_multi_array(int dimensions) { + bool will_link; + ciKlass* klass = stream()->get_klass(will_link); + ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_exhandling(); + + Values* dims = new Values(dimensions, dimensions, NULL); + // fill in all dimensions + int i = dimensions; + while (i-- > 0) dims->at_put(i, ipop()); + // create array + NewArray* n = new NewMultiArray(klass, dims, state_before); + apush(append_split(n)); +} + + +void GraphBuilder::throw_op(int bci) { + // We require that the debug info for a Throw be the "state before" + // the Throw (i.e., exception oop is still on TOS) + ValueStack* state_before = copy_state_before_with_bci(bci); + Throw* t = new Throw(apop(), state_before); + // operand stack not needed after a throw + state()->truncate_stack(0); + append_with_bci(t, bci); +} + + +Value GraphBuilder::round_fp(Value fp_value) { + // no rounding needed if SSE2 is used + if (RoundFPResults && UseSSE < 2) { + // Must currently insert rounding node for doubleword values that + // are results of expressions (i.e., not loads from memory or + // constants) + if (fp_value->type()->tag() == doubleTag && + fp_value->as_Constant() == NULL && + fp_value->as_Local() == NULL && // method parameters need no rounding + fp_value->as_RoundFP() == NULL) { + return append(new RoundFP(fp_value)); + } + } + return fp_value; +} + + +Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) { + Canonicalizer canon(compilation(), instr, bci); + Instruction* i1 = canon.canonical(); + if (i1->is_linked() || !i1->can_be_linked()) { + // Canonicalizer returned an instruction which was already + // appended so simply return it. + return i1; + } + + if (UseLocalValueNumbering) { + // Lookup the instruction in the ValueMap and add it to the map if + // it's not found. + Instruction* i2 = vmap()->find_insert(i1); + if (i2 != i1) { + // found an entry in the value map, so just return it. + assert(i2->is_linked(), "should already be linked"); + return i2; + } + ValueNumberingEffects vne(vmap()); + i1->visit(&vne); + } + + // i1 was not eliminated => append it + assert(i1->next() == NULL, "shouldn't already be linked"); + _last = _last->set_next(i1, canon.bci()); + + if (++_instruction_count >= InstructionCountCutoff && !bailed_out()) { + // set the bailout state but complete normal processing. We + // might do a little more work before noticing the bailout so we + // want processing to continue normally until it's noticed. + bailout("Method and/or inlining is too large"); + } + +#ifndef PRODUCT + if (PrintIRDuringConstruction) { + InstructionPrinter ip; + ip.print_line(i1); + if (Verbose) { + state()->print(); + } + } +#endif + + // save state after modification of operand stack for StateSplit instructions + StateSplit* s = i1->as_StateSplit(); + if (s != NULL) { + if (EliminateFieldAccess) { + Intrinsic* intrinsic = s->as_Intrinsic(); + if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) { + _memory->kill(); + } + } + s->set_state(state()->copy(ValueStack::StateAfter, canon.bci())); + } + + // set up exception handlers for this instruction if necessary + if (i1->can_trap()) { + i1->set_exception_handlers(handle_exception(i1)); + assert(i1->exception_state() != NULL || !i1->needs_exception_state() || bailed_out(), "handle_exception must set exception state"); + } + return i1; +} + + +Instruction* GraphBuilder::append(Instruction* instr) { + assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used"); + return append_with_bci(instr, bci()); +} + + +Instruction* GraphBuilder::append_split(StateSplit* instr) { + return append_with_bci(instr, bci()); +} + + +void GraphBuilder::null_check(Value value) { + if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) { + return; + } else { + Constant* con = value->as_Constant(); + if (con) { + ObjectType* c = con->type()->as_ObjectType(); + if (c && c->is_loaded()) { + ObjectConstant* oc = c->as_ObjectConstant(); + if (!oc || !oc->value()->is_null_object()) { + return; + } + } + } + } + append(new NullCheck(value, copy_state_for_exception())); +} + + + +XHandlers* GraphBuilder::handle_exception(Instruction* instruction) { + if (!has_handler() && (!instruction->needs_exception_state() || instruction->exception_state() != NULL)) { + assert(instruction->exception_state() == NULL + || instruction->exception_state()->kind() == ValueStack::EmptyExceptionState + || (instruction->exception_state()->kind() == ValueStack::ExceptionState && _compilation->env()->should_retain_local_variables()), + "exception_state should be of exception kind"); + return new XHandlers(); + } + + XHandlers* exception_handlers = new XHandlers(); + ScopeData* cur_scope_data = scope_data(); + ValueStack* cur_state = instruction->state_before(); + ValueStack* prev_state = NULL; + int scope_count = 0; + + assert(cur_state != NULL, "state_before must be set"); + do { + int cur_bci = cur_state->bci(); + assert(cur_scope_data->scope() == cur_state->scope(), "scopes do not match"); + assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci"); + + // join with all potential exception handlers + XHandlers* list = cur_scope_data->xhandlers(); + const int n = list->length(); + for (int i = 0; i < n; i++) { + XHandler* h = list->handler_at(i); + if (h->covers(cur_bci)) { + // h is a potential exception handler => join it + compilation()->set_has_exception_handlers(true); + + BlockBegin* entry = h->entry_block(); + if (entry == block()) { + // It's acceptable for an exception handler to cover itself + // but we don't handle that in the parser currently. It's + // very rare so we bailout instead of trying to handle it. + BAILOUT_("exception handler covers itself", exception_handlers); + } + assert(entry->bci() == h->handler_bci(), "must match"); + assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond"); + + // previously this was a BAILOUT, but this is not necessary + // now because asynchronous exceptions are not handled this way. + assert(entry->state() == NULL || cur_state->total_locks_size() == entry->state()->total_locks_size(), "locks do not match"); + + // xhandler start with an empty expression stack + if (cur_state->stack_size() != 0) { + cur_state = cur_state->copy(ValueStack::ExceptionState, cur_state->bci()); + } + if (instruction->exception_state() == NULL) { + instruction->set_exception_state(cur_state); + } + + // Note: Usually this join must work. However, very + // complicated jsr-ret structures where we don't ret from + // the subroutine can cause the objects on the monitor + // stacks to not match because blocks can be parsed twice. + // The only test case we've seen so far which exhibits this + // problem is caught by the infinite recursion test in + // GraphBuilder::jsr() if the join doesn't work. + if (!entry->try_merge(cur_state)) { + BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers); + } + + // add current state for correct handling of phi functions at begin of xhandler + int phi_operand = entry->add_exception_state(cur_state); + + // add entry to the list of xhandlers of this block + _block->add_exception_handler(entry); + + // add back-edge from xhandler entry to this block + if (!entry->is_predecessor(_block)) { + entry->add_predecessor(_block); + } + + // clone XHandler because phi_operand and scope_count can not be shared + XHandler* new_xhandler = new XHandler(h); + new_xhandler->set_phi_operand(phi_operand); + new_xhandler->set_scope_count(scope_count); + exception_handlers->append(new_xhandler); + + // fill in exception handler subgraph lazily + assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet"); + cur_scope_data->add_to_work_list(entry); + + // stop when reaching catchall + if (h->catch_type() == 0) { + return exception_handlers; + } + } + } + + if (exception_handlers->length() == 0) { + // This scope and all callees do not handle exceptions, so the local + // variables of this scope are not needed. However, the scope itself is + // required for a correct exception stack trace -> clear out the locals. + if (_compilation->env()->should_retain_local_variables()) { + cur_state = cur_state->copy(ValueStack::ExceptionState, cur_state->bci()); + } else { + cur_state = cur_state->copy(ValueStack::EmptyExceptionState, cur_state->bci()); + } + if (prev_state != NULL) { + prev_state->set_caller_state(cur_state); + } + if (instruction->exception_state() == NULL) { + instruction->set_exception_state(cur_state); + } + } + + // Set up iteration for next time. + // If parsing a jsr, do not grab exception handlers from the + // parent scopes for this method (already got them, and they + // needed to be cloned) + + while (cur_scope_data->parsing_jsr()) { + cur_scope_data = cur_scope_data->parent(); + } + + assert(cur_scope_data->scope() == cur_state->scope(), "scopes do not match"); + assert(cur_state->locks_size() == 0 || cur_state->locks_size() == 1, "unlocking must be done in a catchall exception handler"); + + prev_state = cur_state; + cur_state = cur_state->caller_state(); + cur_scope_data = cur_scope_data->parent(); + scope_count++; + } while (cur_scope_data != NULL); + + return exception_handlers; +} + + +// Helper class for simplifying Phis. +class PhiSimplifier : public BlockClosure { + private: + bool _has_substitutions; + Value simplify(Value v); + + public: + PhiSimplifier(BlockBegin* start) : _has_substitutions(false) { + start->iterate_preorder(this); + if (_has_substitutions) { + SubstitutionResolver sr(start); + } + } + void block_do(BlockBegin* b); + bool has_substitutions() const { return _has_substitutions; } +}; + + +Value PhiSimplifier::simplify(Value v) { + Phi* phi = v->as_Phi(); + + if (phi == NULL) { + // no phi function + return v; + } else if (v->has_subst()) { + // already substituted; subst can be phi itself -> simplify + return simplify(v->subst()); + } else if (phi->is_set(Phi::cannot_simplify)) { + // already tried to simplify phi before + return phi; + } else if (phi->is_set(Phi::visited)) { + // break cycles in phi functions + return phi; + } else if (phi->type()->is_illegal()) { + // illegal phi functions are ignored anyway + return phi; + + } else { + // mark phi function as processed to break cycles in phi functions + phi->set(Phi::visited); + + // simplify x = [y, x] and x = [y, y] to y + Value subst = NULL; + int opd_count = phi->operand_count(); + for (int i = 0; i < opd_count; i++) { + Value opd = phi->operand_at(i); + assert(opd != NULL, "Operand must exist!"); + + if (opd->type()->is_illegal()) { + // if one operand is illegal, the entire phi function is illegal + phi->make_illegal(); + phi->clear(Phi::visited); + return phi; + } + + Value new_opd = simplify(opd); + assert(new_opd != NULL, "Simplified operand must exist!"); + + if (new_opd != phi && new_opd != subst) { + if (subst == NULL) { + subst = new_opd; + } else { + // no simplification possible + phi->set(Phi::cannot_simplify); + phi->clear(Phi::visited); + return phi; + } + } + } + + // sucessfully simplified phi function + assert(subst != NULL, "illegal phi function"); + _has_substitutions = true; + phi->clear(Phi::visited); + phi->set_subst(subst); + +#ifndef PRODUCT + if (PrintPhiFunctions) { + tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id()); + } +#endif + + return subst; + } +} + + +void PhiSimplifier::block_do(BlockBegin* b) { + for_each_phi_fun(b, phi, + simplify(phi); + ); + +#ifdef ASSERT + for_each_phi_fun(b, phi, + assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification"); + ); + + ValueStack* state = b->state()->caller_state(); + for_each_state_value(state, value, + Phi* phi = value->as_Phi(); + assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state"); + ); +#endif +} + +// This method is called after all blocks are filled with HIR instructions +// It eliminates all Phi functions of the form x = [y, y] and x = [y, x] +void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) { + PhiSimplifier simplifier(start); +} + + +void GraphBuilder::connect_to_end(BlockBegin* beg) { + // setup iteration + kill_all(); + _block = beg; + _state = beg->state()->copy_for_parsing(); + _last = beg; + iterate_bytecodes_for_block(beg->bci()); +} + + +BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) { +#ifndef PRODUCT + if (PrintIRDuringConstruction) { + tty->cr(); + InstructionPrinter ip; + ip.print_instr(_block); tty->cr(); + ip.print_stack(_block->state()); tty->cr(); + ip.print_inline_level(_block); + ip.print_head(); + tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size()); + } +#endif + _skip_block = false; + assert(state() != NULL, "ValueStack missing!"); + CompileLog* log = compilation()->log(); + ciBytecodeStream s(method()); + s.reset_to_bci(bci); + int prev_bci = bci; + scope_data()->set_stream(&s); + // iterate + Bytecodes::Code code = Bytecodes::_illegal; + bool push_exception = false; + + if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) { + // first thing in the exception entry block should be the exception object. + push_exception = true; + } + + bool ignore_return = scope_data()->ignore_return(); + + while (!bailed_out() && last()->as_BlockEnd() == NULL && + (code = stream()->next()) != ciBytecodeStream::EOBC() && + (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) { + assert(state()->kind() == ValueStack::Parsing, "invalid state kind"); + + if (log != NULL) + log->set_context("bc code='%d' bci='%d'", (int)code, s.cur_bci()); + + // Check for active jsr during OSR compilation + if (compilation()->is_osr_compile() + && scope()->is_top_scope() + && parsing_jsr() + && s.cur_bci() == compilation()->osr_bci()) { + bailout("OSR not supported while a jsr is active"); + } + + if (push_exception) { + apush(append(new ExceptionObject())); + push_exception = false; + } + + // handle bytecode + switch (code) { + case Bytecodes::_nop : /* nothing to do */ break; + case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break; + case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break; + case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break; + case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break; + case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break; + case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break; + case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break; + case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break; + case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break; + case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break; + case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break; + case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break; + case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break; + case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break; + case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break; + case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break; + case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break; + case Bytecodes::_ldc : // fall through + case Bytecodes::_ldc_w : // fall through + case Bytecodes::_ldc2_w : load_constant(); break; + case Bytecodes::_iload : load_local(intType , s.get_index()); break; + case Bytecodes::_lload : load_local(longType , s.get_index()); break; + case Bytecodes::_fload : load_local(floatType , s.get_index()); break; + case Bytecodes::_dload : load_local(doubleType , s.get_index()); break; + case Bytecodes::_aload : load_local(instanceType, s.get_index()); break; + case Bytecodes::_iload_0 : load_local(intType , 0); break; + case Bytecodes::_iload_1 : load_local(intType , 1); break; + case Bytecodes::_iload_2 : load_local(intType , 2); break; + case Bytecodes::_iload_3 : load_local(intType , 3); break; + case Bytecodes::_lload_0 : load_local(longType , 0); break; + case Bytecodes::_lload_1 : load_local(longType , 1); break; + case Bytecodes::_lload_2 : load_local(longType , 2); break; + case Bytecodes::_lload_3 : load_local(longType , 3); break; + case Bytecodes::_fload_0 : load_local(floatType , 0); break; + case Bytecodes::_fload_1 : load_local(floatType , 1); break; + case Bytecodes::_fload_2 : load_local(floatType , 2); break; + case Bytecodes::_fload_3 : load_local(floatType , 3); break; + case Bytecodes::_dload_0 : load_local(doubleType, 0); break; + case Bytecodes::_dload_1 : load_local(doubleType, 1); break; + case Bytecodes::_dload_2 : load_local(doubleType, 2); break; + case Bytecodes::_dload_3 : load_local(doubleType, 3); break; + case Bytecodes::_aload_0 : load_local(objectType, 0); break; + case Bytecodes::_aload_1 : load_local(objectType, 1); break; + case Bytecodes::_aload_2 : load_local(objectType, 2); break; + case Bytecodes::_aload_3 : load_local(objectType, 3); break; + case Bytecodes::_iaload : load_indexed(T_INT ); break; + case Bytecodes::_laload : load_indexed(T_LONG ); break; + case Bytecodes::_faload : load_indexed(T_FLOAT ); break; + case Bytecodes::_daload : load_indexed(T_DOUBLE); break; + case Bytecodes::_aaload : load_indexed(T_OBJECT); break; + case Bytecodes::_baload : load_indexed(T_BYTE ); break; + case Bytecodes::_caload : load_indexed(T_CHAR ); break; + case Bytecodes::_saload : load_indexed(T_SHORT ); break; + case Bytecodes::_istore : store_local(intType , s.get_index()); break; + case Bytecodes::_lstore : store_local(longType , s.get_index()); break; + case Bytecodes::_fstore : store_local(floatType , s.get_index()); break; + case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break; + case Bytecodes::_astore : store_local(objectType, s.get_index()); break; + case Bytecodes::_istore_0 : store_local(intType , 0); break; + case Bytecodes::_istore_1 : store_local(intType , 1); break; + case Bytecodes::_istore_2 : store_local(intType , 2); break; + case Bytecodes::_istore_3 : store_local(intType , 3); break; + case Bytecodes::_lstore_0 : store_local(longType , 0); break; + case Bytecodes::_lstore_1 : store_local(longType , 1); break; + case Bytecodes::_lstore_2 : store_local(longType , 2); break; + case Bytecodes::_lstore_3 : store_local(longType , 3); break; + case Bytecodes::_fstore_0 : store_local(floatType , 0); break; + case Bytecodes::_fstore_1 : store_local(floatType , 1); break; + case Bytecodes::_fstore_2 : store_local(floatType , 2); break; + case Bytecodes::_fstore_3 : store_local(floatType , 3); break; + case Bytecodes::_dstore_0 : store_local(doubleType, 0); break; + case Bytecodes::_dstore_1 : store_local(doubleType, 1); break; + case Bytecodes::_dstore_2 : store_local(doubleType, 2); break; + case Bytecodes::_dstore_3 : store_local(doubleType, 3); break; + case Bytecodes::_astore_0 : store_local(objectType, 0); break; + case Bytecodes::_astore_1 : store_local(objectType, 1); break; + case Bytecodes::_astore_2 : store_local(objectType, 2); break; + case Bytecodes::_astore_3 : store_local(objectType, 3); break; + case Bytecodes::_iastore : store_indexed(T_INT ); break; + case Bytecodes::_lastore : store_indexed(T_LONG ); break; + case Bytecodes::_fastore : store_indexed(T_FLOAT ); break; + case Bytecodes::_dastore : store_indexed(T_DOUBLE); break; + case Bytecodes::_aastore : store_indexed(T_OBJECT); break; + case Bytecodes::_bastore : store_indexed(T_BYTE ); break; + case Bytecodes::_castore : store_indexed(T_CHAR ); break; + case Bytecodes::_sastore : store_indexed(T_SHORT ); break; + case Bytecodes::_pop : // fall through + case Bytecodes::_pop2 : // fall through + case Bytecodes::_dup : // fall through + case Bytecodes::_dup_x1 : // fall through + case Bytecodes::_dup_x2 : // fall through + case Bytecodes::_dup2 : // fall through + case Bytecodes::_dup2_x1 : // fall through + case Bytecodes::_dup2_x2 : // fall through + case Bytecodes::_swap : stack_op(code); break; + case Bytecodes::_iadd : arithmetic_op(intType , code); break; + case Bytecodes::_ladd : arithmetic_op(longType , code); break; + case Bytecodes::_fadd : arithmetic_op(floatType , code); break; + case Bytecodes::_dadd : arithmetic_op(doubleType, code); break; + case Bytecodes::_isub : arithmetic_op(intType , code); break; + case Bytecodes::_lsub : arithmetic_op(longType , code); break; + case Bytecodes::_fsub : arithmetic_op(floatType , code); break; + case Bytecodes::_dsub : arithmetic_op(doubleType, code); break; + case Bytecodes::_imul : arithmetic_op(intType , code); break; + case Bytecodes::_lmul : arithmetic_op(longType , code); break; + case Bytecodes::_fmul : arithmetic_op(floatType , code); break; + case Bytecodes::_dmul : arithmetic_op(doubleType, code); break; + case Bytecodes::_idiv : arithmetic_op(intType , code, copy_state_for_exception()); break; + case Bytecodes::_ldiv : arithmetic_op(longType , code, copy_state_for_exception()); break; + case Bytecodes::_fdiv : arithmetic_op(floatType , code); break; + case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break; + case Bytecodes::_irem : arithmetic_op(intType , code, copy_state_for_exception()); break; + case Bytecodes::_lrem : arithmetic_op(longType , code, copy_state_for_exception()); break; + case Bytecodes::_frem : arithmetic_op(floatType , code); break; + case Bytecodes::_drem : arithmetic_op(doubleType, code); break; + case Bytecodes::_ineg : negate_op(intType ); break; + case Bytecodes::_lneg : negate_op(longType ); break; + case Bytecodes::_fneg : negate_op(floatType ); break; + case Bytecodes::_dneg : negate_op(doubleType); break; + case Bytecodes::_ishl : shift_op(intType , code); break; + case Bytecodes::_lshl : shift_op(longType, code); break; + case Bytecodes::_ishr : shift_op(intType , code); break; + case Bytecodes::_lshr : shift_op(longType, code); break; + case Bytecodes::_iushr : shift_op(intType , code); break; + case Bytecodes::_lushr : shift_op(longType, code); break; + case Bytecodes::_iand : logic_op(intType , code); break; + case Bytecodes::_land : logic_op(longType, code); break; + case Bytecodes::_ior : logic_op(intType , code); break; + case Bytecodes::_lor : logic_op(longType, code); break; + case Bytecodes::_ixor : logic_op(intType , code); break; + case Bytecodes::_lxor : logic_op(longType, code); break; + case Bytecodes::_iinc : increment(); break; + case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break; + case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break; + case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break; + case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break; + case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break; + case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break; + case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break; + case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break; + case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break; + case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break; + case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break; + case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break; + case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break; + case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break; + case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break; + case Bytecodes::_lcmp : compare_op(longType , code); break; + case Bytecodes::_fcmpl : compare_op(floatType , code); break; + case Bytecodes::_fcmpg : compare_op(floatType , code); break; + case Bytecodes::_dcmpl : compare_op(doubleType, code); break; + case Bytecodes::_dcmpg : compare_op(doubleType, code); break; + case Bytecodes::_ifeq : if_zero(intType , If::eql); break; + case Bytecodes::_ifne : if_zero(intType , If::neq); break; + case Bytecodes::_iflt : if_zero(intType , If::lss); break; + case Bytecodes::_ifge : if_zero(intType , If::geq); break; + case Bytecodes::_ifgt : if_zero(intType , If::gtr); break; + case Bytecodes::_ifle : if_zero(intType , If::leq); break; + case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break; + case Bytecodes::_if_icmpne : if_same(intType , If::neq); break; + case Bytecodes::_if_icmplt : if_same(intType , If::lss); break; + case Bytecodes::_if_icmpge : if_same(intType , If::geq); break; + case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break; + case Bytecodes::_if_icmple : if_same(intType , If::leq); break; + case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break; + case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break; + case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break; + case Bytecodes::_jsr : jsr(s.get_dest()); break; + case Bytecodes::_ret : ret(s.get_index()); break; + case Bytecodes::_tableswitch : table_switch(); break; + case Bytecodes::_lookupswitch : lookup_switch(); break; + case Bytecodes::_ireturn : method_return(ipop(), ignore_return); break; + case Bytecodes::_lreturn : method_return(lpop(), ignore_return); break; + case Bytecodes::_freturn : method_return(fpop(), ignore_return); break; + case Bytecodes::_dreturn : method_return(dpop(), ignore_return); break; + case Bytecodes::_areturn : method_return(apop(), ignore_return); break; + case Bytecodes::_return : method_return(NULL , ignore_return); break; + case Bytecodes::_getstatic : // fall through + case Bytecodes::_putstatic : // fall through + case Bytecodes::_getfield : // fall through + case Bytecodes::_putfield : access_field(code); break; + case Bytecodes::_invokevirtual : // fall through + case Bytecodes::_invokespecial : // fall through + case Bytecodes::_invokestatic : // fall through + case Bytecodes::_invokedynamic : // fall through + case Bytecodes::_invokeinterface: invoke(code); break; + case Bytecodes::_new : new_instance(s.get_index_u2()); break; + case Bytecodes::_newarray : new_type_array(); break; + case Bytecodes::_anewarray : new_object_array(); break; + case Bytecodes::_arraylength : { ValueStack* state_before = copy_state_for_exception(); ipush(append(new ArrayLength(apop(), state_before))); break; } + case Bytecodes::_athrow : throw_op(s.cur_bci()); break; + case Bytecodes::_checkcast : check_cast(s.get_index_u2()); break; + case Bytecodes::_instanceof : instance_of(s.get_index_u2()); break; + case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break; + case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break; + case Bytecodes::_wide : ShouldNotReachHere(); break; + case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break; + case Bytecodes::_ifnull : if_null(objectType, If::eql); break; + case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break; + case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break; + case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break; + case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL); + default : ShouldNotReachHere(); break; + } + + if (log != NULL) + log->clear_context(); // skip marker if nothing was printed + + // save current bci to setup Goto at the end + prev_bci = s.cur_bci(); + + } + CHECK_BAILOUT_(NULL); + // stop processing of this block (see try_inline_full) + if (_skip_block) { + _skip_block = false; + assert(_last && _last->as_BlockEnd(), ""); + return _last->as_BlockEnd(); + } + // if there are any, check if last instruction is a BlockEnd instruction + BlockEnd* end = last()->as_BlockEnd(); + if (end == NULL) { + // all blocks must end with a BlockEnd instruction => add a Goto + end = new Goto(block_at(s.cur_bci()), false); + append(end); + } + assert(end == last()->as_BlockEnd(), "inconsistency"); + + assert(end->state() != NULL, "state must already be present"); + assert(end->as_Return() == NULL || end->as_Throw() == NULL || end->state()->stack_size() == 0, "stack not needed for return and throw"); + + // connect to begin & set state + // NOTE that inlining may have changed the block we are parsing + block()->set_end(end); + // propagate state + for (int i = end->number_of_sux() - 1; i >= 0; i--) { + BlockBegin* sux = end->sux_at(i); + assert(sux->is_predecessor(block()), "predecessor missing"); + // be careful, bailout if bytecodes are strange + if (!sux->try_merge(end->state())) BAILOUT_("block join failed", NULL); + scope_data()->add_to_work_list(end->sux_at(i)); + } + + scope_data()->set_stream(NULL); + + // done + return end; +} + + +void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) { + do { + if (start_in_current_block_for_inlining && !bailed_out()) { + iterate_bytecodes_for_block(0); + start_in_current_block_for_inlining = false; + } else { + BlockBegin* b; + while ((b = scope_data()->remove_from_work_list()) != NULL) { + if (!b->is_set(BlockBegin::was_visited_flag)) { + if (b->is_set(BlockBegin::osr_entry_flag)) { + // we're about to parse the osr entry block, so make sure + // we setup the OSR edge leading into this block so that + // Phis get setup correctly. + setup_osr_entry_block(); + // this is no longer the osr entry block, so clear it. + b->clear(BlockBegin::osr_entry_flag); + } + b->set(BlockBegin::was_visited_flag); + connect_to_end(b); + } + } + } + } while (!bailed_out() && !scope_data()->is_work_list_empty()); +} + + +bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes]; + +void GraphBuilder::initialize() { + // the following bytecodes are assumed to potentially + // throw exceptions in compiled code - note that e.g. + // monitorexit & the return bytecodes do not throw + // exceptions since monitor pairing proved that they + // succeed (if monitor pairing succeeded) + Bytecodes::Code can_trap_list[] = + { Bytecodes::_ldc + , Bytecodes::_ldc_w + , Bytecodes::_ldc2_w + , Bytecodes::_iaload + , Bytecodes::_laload + , Bytecodes::_faload + , Bytecodes::_daload + , Bytecodes::_aaload + , Bytecodes::_baload + , Bytecodes::_caload + , Bytecodes::_saload + , Bytecodes::_iastore + , Bytecodes::_lastore + , Bytecodes::_fastore + , Bytecodes::_dastore + , Bytecodes::_aastore + , Bytecodes::_bastore + , Bytecodes::_castore + , Bytecodes::_sastore + , Bytecodes::_idiv + , Bytecodes::_ldiv + , Bytecodes::_irem + , Bytecodes::_lrem + , Bytecodes::_getstatic + , Bytecodes::_putstatic + , Bytecodes::_getfield + , Bytecodes::_putfield + , Bytecodes::_invokevirtual + , Bytecodes::_invokespecial + , Bytecodes::_invokestatic + , Bytecodes::_invokedynamic + , Bytecodes::_invokeinterface + , Bytecodes::_new + , Bytecodes::_newarray + , Bytecodes::_anewarray + , Bytecodes::_arraylength + , Bytecodes::_athrow + , Bytecodes::_checkcast + , Bytecodes::_instanceof + , Bytecodes::_monitorenter + , Bytecodes::_multianewarray + }; + + // inititialize trap tables + for (int i = 0; i < Bytecodes::number_of_java_codes; i++) { + _can_trap[i] = false; + } + // set standard trap info + for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) { + _can_trap[can_trap_list[j]] = true; + } +} + + +BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) { + assert(entry->is_set(f), "entry/flag mismatch"); + // create header block + BlockBegin* h = new BlockBegin(entry->bci()); + h->set_depth_first_number(0); + + Value l = h; + BlockEnd* g = new Goto(entry, false); + l->set_next(g, entry->bci()); + h->set_end(g); + h->set(f); + // setup header block end state + ValueStack* s = state->copy(ValueStack::StateAfter, entry->bci()); // can use copy since stack is empty (=> no phis) + assert(s->stack_is_empty(), "must have empty stack at entry point"); + g->set_state(s); + return h; +} + + + +BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) { + BlockBegin* start = new BlockBegin(0); + + // This code eliminates the empty start block at the beginning of + // each method. Previously, each method started with the + // start-block created below, and this block was followed by the + // header block that was always empty. This header block is only + // necesary if std_entry is also a backward branch target because + // then phi functions may be necessary in the header block. It's + // also necessary when profiling so that there's a single block that + // can increment the interpreter_invocation_count. + BlockBegin* new_header_block; + if (std_entry->number_of_preds() > 0 || count_invocations() || count_backedges()) { + new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state); + } else { + new_header_block = std_entry; + } + + // setup start block (root for the IR graph) + Base* base = + new Base( + new_header_block, + osr_entry + ); + start->set_next(base, 0); + start->set_end(base); + // create & setup state for start block + start->set_state(state->copy(ValueStack::StateAfter, std_entry->bci())); + base->set_state(state->copy(ValueStack::StateAfter, std_entry->bci())); + + if (base->std_entry()->state() == NULL) { + // setup states for header blocks + base->std_entry()->merge(state); + } + + assert(base->std_entry()->state() != NULL, ""); + return start; +} + + +void GraphBuilder::setup_osr_entry_block() { + assert(compilation()->is_osr_compile(), "only for osrs"); + + int osr_bci = compilation()->osr_bci(); + ciBytecodeStream s(method()); + s.reset_to_bci(osr_bci); + s.next(); + scope_data()->set_stream(&s); + + // create a new block to be the osr setup code + _osr_entry = new BlockBegin(osr_bci); + _osr_entry->set(BlockBegin::osr_entry_flag); + _osr_entry->set_depth_first_number(0); + BlockBegin* target = bci2block()->at(osr_bci); + assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there"); + // the osr entry has no values for locals + ValueStack* state = target->state()->copy(); + _osr_entry->set_state(state); + + kill_all(); + _block = _osr_entry; + _state = _osr_entry->state()->copy(); + assert(_state->bci() == osr_bci, "mismatch"); + _last = _osr_entry; + Value e = append(new OsrEntry()); + e->set_needs_null_check(false); + + // OSR buffer is + // + // locals[nlocals-1..0] + // monitors[number_of_locks-1..0] + // + // locals is a direct copy of the interpreter frame so in the osr buffer + // so first slot in the local array is the last local from the interpreter + // and last slot is local[0] (receiver) from the interpreter + // + // Similarly with locks. The first lock slot in the osr buffer is the nth lock + // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock + // in the interpreter frame (the method lock if a sync method) + + // Initialize monitors in the compiled activation. + + int index; + Value local; + + // find all the locals that the interpreter thinks contain live oops + const ResourceBitMap live_oops = method()->live_local_oops_at_bci(osr_bci); + + // compute the offset into the locals so that we can treat the buffer + // as if the locals were still in the interpreter frame + int locals_offset = BytesPerWord * (method()->max_locals() - 1); + for_each_local_value(state, index, local) { + int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord; + Value get; + if (local->type()->is_object_kind() && !live_oops.at(index)) { + // The interpreter thinks this local is dead but the compiler + // doesn't so pretend that the interpreter passed in null. + get = append(new Constant(objectNull)); + } else { + get = append(new UnsafeGetRaw(as_BasicType(local->type()), e, + append(new Constant(new IntConstant(offset))), + 0, + true /*unaligned*/, true /*wide*/)); + } + _state->store_local(index, get); + } + + // the storage for the OSR buffer is freed manually in the LIRGenerator. + + assert(state->caller_state() == NULL, "should be top scope"); + state->clear_locals(); + Goto* g = new Goto(target, false); + append(g); + _osr_entry->set_end(g); + target->merge(_osr_entry->end()->state()); + + scope_data()->set_stream(NULL); +} + + +ValueStack* GraphBuilder::state_at_entry() { + ValueStack* state = new ValueStack(scope(), NULL); + + // Set up locals for receiver + int idx = 0; + if (!method()->is_static()) { + // we should always see the receiver + state->store_local(idx, new Local(method()->holder(), objectType, idx, true)); + idx = 1; + } + + // Set up locals for incoming arguments + ciSignature* sig = method()->signature(); + for (int i = 0; i < sig->count(); i++) { + ciType* type = sig->type_at(i); + BasicType basic_type = type->basic_type(); + // don't allow T_ARRAY to propagate into locals types + if (basic_type == T_ARRAY) basic_type = T_OBJECT; + ValueType* vt = as_ValueType(basic_type); + state->store_local(idx, new Local(type, vt, idx, false)); + idx += type->size(); + } + + // lock synchronized method + if (method()->is_synchronized()) { + state->lock(NULL); + } + + return state; +} + + +GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope) + : _scope_data(NULL) + , _instruction_count(0) + , _osr_entry(NULL) + , _memory(new MemoryBuffer()) + , _compilation(compilation) + , _inline_bailout_msg(NULL) +{ + int osr_bci = compilation->osr_bci(); + + // determine entry points and bci2block mapping + BlockListBuilder blm(compilation, scope, osr_bci); + CHECK_BAILOUT(); + + BlockList* bci2block = blm.bci2block(); + BlockBegin* start_block = bci2block->at(0); + + push_root_scope(scope, bci2block, start_block); + + // setup state for std entry + _initial_state = state_at_entry(); + start_block->merge(_initial_state); + + // complete graph + _vmap = new ValueMap(); + switch (scope->method()->intrinsic_id()) { + case vmIntrinsics::_dabs : // fall through + case vmIntrinsics::_dsqrt : // fall through + case vmIntrinsics::_dsin : // fall through + case vmIntrinsics::_dcos : // fall through + case vmIntrinsics::_dtan : // fall through + case vmIntrinsics::_dlog : // fall through + case vmIntrinsics::_dlog10 : // fall through + case vmIntrinsics::_dexp : // fall through + case vmIntrinsics::_dpow : // fall through + { + // Compiles where the root method is an intrinsic need a special + // compilation environment because the bytecodes for the method + // shouldn't be parsed during the compilation, only the special + // Intrinsic node should be emitted. If this isn't done the the + // code for the inlined version will be different than the root + // compiled version which could lead to monotonicity problems on + // intel. + if (CheckIntrinsics && !scope->method()->intrinsic_candidate()) { + BAILOUT("failed to inline intrinsic, method not annotated"); + } + + // Set up a stream so that appending instructions works properly. + ciBytecodeStream s(scope->method()); + s.reset_to_bci(0); + scope_data()->set_stream(&s); + s.next(); + + // setup the initial block state + _block = start_block; + _state = start_block->state()->copy_for_parsing(); + _last = start_block; + load_local(doubleType, 0); + if (scope->method()->intrinsic_id() == vmIntrinsics::_dpow) { + load_local(doubleType, 2); + } + + // Emit the intrinsic node. + bool result = try_inline_intrinsics(scope->method()); + if (!result) BAILOUT("failed to inline intrinsic"); + method_return(dpop()); + + // connect the begin and end blocks and we're all done. + BlockEnd* end = last()->as_BlockEnd(); + block()->set_end(end); + break; + } + + case vmIntrinsics::_Reference_get: + { + { + // With java.lang.ref.reference.get() we must go through the + // intrinsic - when G1 is enabled - even when get() is the root + // method of the compile so that, if necessary, the value in + // the referent field of the reference object gets recorded by + // the pre-barrier code. + // Specifically, if G1 is enabled, the value in the referent + // field is recorded by the G1 SATB pre barrier. This will + // result in the referent being marked live and the reference + // object removed from the list of discovered references during + // reference processing. + if (CheckIntrinsics && !scope->method()->intrinsic_candidate()) { + BAILOUT("failed to inline intrinsic, method not annotated"); + } + + // Also we need intrinsic to prevent commoning reads from this field + // across safepoint since GC can change its value. + + // Set up a stream so that appending instructions works properly. + ciBytecodeStream s(scope->method()); + s.reset_to_bci(0); + scope_data()->set_stream(&s); + s.next(); + + // setup the initial block state + _block = start_block; + _state = start_block->state()->copy_for_parsing(); + _last = start_block; + load_local(objectType, 0); + + // Emit the intrinsic node. + bool result = try_inline_intrinsics(scope->method()); + if (!result) BAILOUT("failed to inline intrinsic"); + method_return(apop()); + + // connect the begin and end blocks and we're all done. + BlockEnd* end = last()->as_BlockEnd(); + block()->set_end(end); + break; + } + // Otherwise, fall thru + } + + default: + scope_data()->add_to_work_list(start_block); + iterate_all_blocks(); + break; + } + CHECK_BAILOUT(); + + _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state); + + eliminate_redundant_phis(_start); + + NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats()); + // for osr compile, bailout if some requirements are not fulfilled + if (osr_bci != -1) { + BlockBegin* osr_block = blm.bci2block()->at(osr_bci); + if (!osr_block->is_set(BlockBegin::was_visited_flag)) { + BAILOUT("osr entry must have been visited for osr compile"); + } + + // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points + if (!osr_block->state()->stack_is_empty()) { + BAILOUT("stack not empty at OSR entry point"); + } + } +#ifndef PRODUCT + if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count); +#endif +} + + +ValueStack* GraphBuilder::copy_state_before() { + return copy_state_before_with_bci(bci()); +} + +ValueStack* GraphBuilder::copy_state_exhandling() { + return copy_state_exhandling_with_bci(bci()); +} + +ValueStack* GraphBuilder::copy_state_for_exception() { + return copy_state_for_exception_with_bci(bci()); +} + +ValueStack* GraphBuilder::copy_state_before_with_bci(int bci) { + return state()->copy(ValueStack::StateBefore, bci); +} + +ValueStack* GraphBuilder::copy_state_exhandling_with_bci(int bci) { + if (!has_handler()) return NULL; + return state()->copy(ValueStack::StateBefore, bci); +} + +ValueStack* GraphBuilder::copy_state_for_exception_with_bci(int bci) { + ValueStack* s = copy_state_exhandling_with_bci(bci); + if (s == NULL) { + if (_compilation->env()->should_retain_local_variables()) { + s = state()->copy(ValueStack::ExceptionState, bci); + } else { + s = state()->copy(ValueStack::EmptyExceptionState, bci); + } + } + return s; +} + +int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const { + int recur_level = 0; + for (IRScope* s = scope(); s != NULL; s = s->caller()) { + if (s->method() == cur_callee) { + ++recur_level; + } + } + return recur_level; +} + + +bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known, bool ignore_return, Bytecodes::Code bc, Value receiver) { + const char* msg = NULL; + + // clear out any existing inline bailout condition + clear_inline_bailout(); + + // exclude methods we don't want to inline + msg = should_not_inline(callee); + if (msg != NULL) { + print_inlining(callee, msg, /*success*/ false); + return false; + } + + // method handle invokes + if (callee->is_method_handle_intrinsic()) { + if (try_method_handle_inline(callee, ignore_return)) { + if (callee->has_reserved_stack_access()) { + compilation()->set_has_reserved_stack_access(true); + } + return true; + } + return false; + } + + // handle intrinsics + if (callee->intrinsic_id() != vmIntrinsics::_none && + (CheckIntrinsics ? callee->intrinsic_candidate() : true)) { + if (try_inline_intrinsics(callee, ignore_return)) { + print_inlining(callee, "intrinsic"); + if (callee->has_reserved_stack_access()) { + compilation()->set_has_reserved_stack_access(true); + } + return true; + } + // try normal inlining + } + + // certain methods cannot be parsed at all + msg = check_can_parse(callee); + if (msg != NULL) { + print_inlining(callee, msg, /*success*/ false); + return false; + } + + // If bytecode not set use the current one. + if (bc == Bytecodes::_illegal) { + bc = code(); + } + if (try_inline_full(callee, holder_known, ignore_return, bc, receiver)) { + if (callee->has_reserved_stack_access()) { + compilation()->set_has_reserved_stack_access(true); + } + return true; + } + + // Entire compilation could fail during try_inline_full call. + // In that case printing inlining decision info is useless. + if (!bailed_out()) + print_inlining(callee, _inline_bailout_msg, /*success*/ false); + + return false; +} + + +const char* GraphBuilder::check_can_parse(ciMethod* callee) const { + // Certain methods cannot be parsed at all: + if ( callee->is_native()) return "native method"; + if ( callee->is_abstract()) return "abstract method"; + if (!callee->can_be_compiled()) return "not compilable (disabled)"; + return NULL; +} + +// negative filter: should callee NOT be inlined? returns NULL, ok to inline, or rejection msg +const char* GraphBuilder::should_not_inline(ciMethod* callee) const { + if ( compilation()->directive()->should_not_inline(callee)) return "disallowed by CompileCommand"; + if ( callee->dont_inline()) return "don't inline by annotation"; + return NULL; +} + +void GraphBuilder::build_graph_for_intrinsic(ciMethod* callee, bool ignore_return) { + vmIntrinsics::ID id = callee->intrinsic_id(); + assert(id != vmIntrinsics::_none, "must be a VM intrinsic"); + + // Some intrinsics need special IR nodes. + switch(id) { + case vmIntrinsics::_getObject : append_unsafe_get_obj(callee, T_OBJECT, false); return; + case vmIntrinsics::_getBoolean : append_unsafe_get_obj(callee, T_BOOLEAN, false); return; + case vmIntrinsics::_getByte : append_unsafe_get_obj(callee, T_BYTE, false); return; + case vmIntrinsics::_getShort : append_unsafe_get_obj(callee, T_SHORT, false); return; + case vmIntrinsics::_getChar : append_unsafe_get_obj(callee, T_CHAR, false); return; + case vmIntrinsics::_getInt : append_unsafe_get_obj(callee, T_INT, false); return; + case vmIntrinsics::_getLong : append_unsafe_get_obj(callee, T_LONG, false); return; + case vmIntrinsics::_getFloat : append_unsafe_get_obj(callee, T_FLOAT, false); return; + case vmIntrinsics::_getDouble : append_unsafe_get_obj(callee, T_DOUBLE, false); return; + case vmIntrinsics::_putObject : append_unsafe_put_obj(callee, T_OBJECT, false); return; + case vmIntrinsics::_putBoolean : append_unsafe_put_obj(callee, T_BOOLEAN, false); return; + case vmIntrinsics::_putByte : append_unsafe_put_obj(callee, T_BYTE, false); return; + case vmIntrinsics::_putShort : append_unsafe_put_obj(callee, T_SHORT, false); return; + case vmIntrinsics::_putChar : append_unsafe_put_obj(callee, T_CHAR, false); return; + case vmIntrinsics::_putInt : append_unsafe_put_obj(callee, T_INT, false); return; + case vmIntrinsics::_putLong : append_unsafe_put_obj(callee, T_LONG, false); return; + case vmIntrinsics::_putFloat : append_unsafe_put_obj(callee, T_FLOAT, false); return; + case vmIntrinsics::_putDouble : append_unsafe_put_obj(callee, T_DOUBLE, false); return; + case vmIntrinsics::_getShortUnaligned : append_unsafe_get_obj(callee, T_SHORT, false); return; + case vmIntrinsics::_getCharUnaligned : append_unsafe_get_obj(callee, T_CHAR, false); return; + case vmIntrinsics::_getIntUnaligned : append_unsafe_get_obj(callee, T_INT, false); return; + case vmIntrinsics::_getLongUnaligned : append_unsafe_get_obj(callee, T_LONG, false); return; + case vmIntrinsics::_putShortUnaligned : append_unsafe_put_obj(callee, T_SHORT, false); return; + case vmIntrinsics::_putCharUnaligned : append_unsafe_put_obj(callee, T_CHAR, false); return; + case vmIntrinsics::_putIntUnaligned : append_unsafe_put_obj(callee, T_INT, false); return; + case vmIntrinsics::_putLongUnaligned : append_unsafe_put_obj(callee, T_LONG, false); return; + case vmIntrinsics::_getObjectVolatile : append_unsafe_get_obj(callee, T_OBJECT, true); return; + case vmIntrinsics::_getBooleanVolatile : append_unsafe_get_obj(callee, T_BOOLEAN, true); return; + case vmIntrinsics::_getByteVolatile : append_unsafe_get_obj(callee, T_BYTE, true); return; + case vmIntrinsics::_getShortVolatile : append_unsafe_get_obj(callee, T_SHORT, true); return; + case vmIntrinsics::_getCharVolatile : append_unsafe_get_obj(callee, T_CHAR, true); return; + case vmIntrinsics::_getIntVolatile : append_unsafe_get_obj(callee, T_INT, true); return; + case vmIntrinsics::_getLongVolatile : append_unsafe_get_obj(callee, T_LONG, true); return; + case vmIntrinsics::_getFloatVolatile : append_unsafe_get_obj(callee, T_FLOAT, true); return; + case vmIntrinsics::_getDoubleVolatile : append_unsafe_get_obj(callee, T_DOUBLE, true); return; + case vmIntrinsics::_putObjectVolatile : append_unsafe_put_obj(callee, T_OBJECT, true); return; + case vmIntrinsics::_putBooleanVolatile : append_unsafe_put_obj(callee, T_BOOLEAN, true); return; + case vmIntrinsics::_putByteVolatile : append_unsafe_put_obj(callee, T_BYTE, true); return; + case vmIntrinsics::_putShortVolatile : append_unsafe_put_obj(callee, T_SHORT, true); return; + case vmIntrinsics::_putCharVolatile : append_unsafe_put_obj(callee, T_CHAR, true); return; + case vmIntrinsics::_putIntVolatile : append_unsafe_put_obj(callee, T_INT, true); return; + case vmIntrinsics::_putLongVolatile : append_unsafe_put_obj(callee, T_LONG, true); return; + case vmIntrinsics::_putFloatVolatile : append_unsafe_put_obj(callee, T_FLOAT, true); return; + case vmIntrinsics::_putDoubleVolatile : append_unsafe_put_obj(callee, T_DOUBLE, true); return; + case vmIntrinsics::_compareAndSetLong: + case vmIntrinsics::_compareAndSetInt: + case vmIntrinsics::_compareAndSetObject: append_unsafe_CAS(callee); return; + case vmIntrinsics::_getAndAddInt: + case vmIntrinsics::_getAndAddLong : append_unsafe_get_and_set_obj(callee, true); return; + case vmIntrinsics::_getAndSetInt : + case vmIntrinsics::_getAndSetLong : + case vmIntrinsics::_getAndSetObject : append_unsafe_get_and_set_obj(callee, false); return; + case vmIntrinsics::_getCharStringU : append_char_access(callee, false); return; + case vmIntrinsics::_putCharStringU : append_char_access(callee, true); return; + default: + break; + } + + // create intrinsic node + const bool has_receiver = !callee->is_static(); + ValueType* result_type = as_ValueType(callee->return_type()); + ValueStack* state_before = copy_state_for_exception(); + + Values* args = state()->pop_arguments(callee->arg_size()); + + if (is_profiling()) { + // Don't profile in the special case where the root method + // is the intrinsic + if (callee != method()) { + // Note that we'd collect profile data in this method if we wanted it. + compilation()->set_would_profile(true); + if (profile_calls()) { + Value recv = NULL; + if (has_receiver) { + recv = args->at(0); + null_check(recv); + } + profile_call(callee, recv, NULL, collect_args_for_profiling(args, callee, true), true); + } + } + } + + Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), + args, has_receiver, state_before, + vmIntrinsics::preserves_state(id), + vmIntrinsics::can_trap(id)); + // append instruction & push result + Value value = append_split(result); + if (result_type != voidType && !ignore_return) { + push(result_type, value); + } + + if (callee != method() && profile_return() && result_type->is_object_kind()) { + profile_return_type(result, callee); + } +} + +bool GraphBuilder::try_inline_intrinsics(ciMethod* callee, bool ignore_return) { + // For calling is_intrinsic_available we need to transition to + // the '_thread_in_vm' state because is_intrinsic_available() + // accesses critical VM-internal data. + bool is_available = false; + { + VM_ENTRY_MARK; + methodHandle mh(THREAD, callee->get_Method()); + is_available = _compilation->compiler()->is_intrinsic_available(mh, _compilation->directive()); + } + + if (!is_available) { + if (!InlineNatives) { + // Return false and also set message that the inlining of + // intrinsics has been disabled in general. + INLINE_BAILOUT("intrinsic method inlining disabled"); + } else { + return false; + } + } + build_graph_for_intrinsic(callee, ignore_return); + return true; +} + + +bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) { + // Introduce a new callee continuation point - all Ret instructions + // will be replaced with Gotos to this point. + BlockBegin* cont = block_at(next_bci()); + assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr"); + + // Note: can not assign state to continuation yet, as we have to + // pick up the state from the Ret instructions. + + // Push callee scope + push_scope_for_jsr(cont, jsr_dest_bci); + + // Temporarily set up bytecode stream so we can append instructions + // (only using the bci of this stream) + scope_data()->set_stream(scope_data()->parent()->stream()); + + BlockBegin* jsr_start_block = block_at(jsr_dest_bci); + assert(jsr_start_block != NULL, "jsr start block must exist"); + assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet"); + Goto* goto_sub = new Goto(jsr_start_block, false); + // Must copy state to avoid wrong sharing when parsing bytecodes + assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block"); + jsr_start_block->set_state(copy_state_before_with_bci(jsr_dest_bci)); + append(goto_sub); + _block->set_end(goto_sub); + _last = _block = jsr_start_block; + + // Clear out bytecode stream + scope_data()->set_stream(NULL); + + scope_data()->add_to_work_list(jsr_start_block); + + // Ready to resume parsing in subroutine + iterate_all_blocks(); + + // If we bailed out during parsing, return immediately (this is bad news) + CHECK_BAILOUT_(false); + + // Detect whether the continuation can actually be reached. If not, + // it has not had state set by the join() operations in + // iterate_bytecodes_for_block()/ret() and we should not touch the + // iteration state. The calling activation of + // iterate_bytecodes_for_block will then complete normally. + if (cont->state() != NULL) { + if (!cont->is_set(BlockBegin::was_visited_flag)) { + // add continuation to work list instead of parsing it immediately + scope_data()->parent()->add_to_work_list(cont); + } + } + + assert(jsr_continuation() == cont, "continuation must not have changed"); + assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) || + jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag), + "continuation can only be visited in case of backward branches"); + assert(_last && _last->as_BlockEnd(), "block must have end"); + + // continuation is in work list, so end iteration of current block + _skip_block = true; + pop_scope_for_jsr(); + + return true; +} + + +// Inline the entry of a synchronized method as a monitor enter and +// register the exception handler which releases the monitor if an +// exception is thrown within the callee. Note that the monitor enter +// cannot throw an exception itself, because the receiver is +// guaranteed to be non-null by the explicit null check at the +// beginning of inlining. +void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) { + assert(lock != NULL && sync_handler != NULL, "lock or handler missing"); + + monitorenter(lock, SynchronizationEntryBCI); + assert(_last->as_MonitorEnter() != NULL, "monitor enter expected"); + _last->set_needs_null_check(false); + + sync_handler->set(BlockBegin::exception_entry_flag); + sync_handler->set(BlockBegin::is_on_work_list_flag); + + ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); + XHandler* h = new XHandler(desc); + h->set_entry_block(sync_handler); + scope_data()->xhandlers()->append(h); + scope_data()->set_has_handler(); +} + + +// If an exception is thrown and not handled within an inlined +// synchronized method, the monitor must be released before the +// exception is rethrown in the outer scope. Generate the appropriate +// instructions here. +void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) { + BlockBegin* orig_block = _block; + ValueStack* orig_state = _state; + Instruction* orig_last = _last; + _last = _block = sync_handler; + _state = sync_handler->state()->copy(); + + assert(sync_handler != NULL, "handler missing"); + assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here"); + + assert(lock != NULL || default_handler, "lock or handler missing"); + + XHandler* h = scope_data()->xhandlers()->remove_last(); + assert(h->entry_block() == sync_handler, "corrupt list of handlers"); + + block()->set(BlockBegin::was_visited_flag); + Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI); + assert(exception->is_pinned(), "must be"); + + int bci = SynchronizationEntryBCI; + if (compilation()->env()->dtrace_method_probes()) { + // Report exit from inline methods. We don't have a stream here + // so pass an explicit bci of SynchronizationEntryBCI. + Values* args = new Values(1); + args->push(append_with_bci(new Constant(new MethodConstant(method())), bci)); + append_with_bci(new RuntimeCall(voidType, "dtrace_method_exit", CAST_FROM_FN_PTR(address, SharedRuntime::dtrace_method_exit), args), bci); + } + + if (lock) { + assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing"); + if (!lock->is_linked()) { + lock = append_with_bci(lock, bci); + } + + // exit the monitor in the context of the synchronized method + monitorexit(lock, bci); + + // exit the context of the synchronized method + if (!default_handler) { + pop_scope(); + bci = _state->caller_state()->bci(); + _state = _state->caller_state()->copy_for_parsing(); + } + } + + // perform the throw as if at the the call site + apush(exception); + throw_op(bci); + + BlockEnd* end = last()->as_BlockEnd(); + block()->set_end(end); + + _block = orig_block; + _state = orig_state; + _last = orig_last; +} + + +bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known, bool ignore_return, Bytecodes::Code bc, Value receiver) { + assert(!callee->is_native(), "callee must not be native"); + if (CompilationPolicy::policy()->should_not_inline(compilation()->env(), callee)) { + INLINE_BAILOUT("inlining prohibited by policy"); + } + // first perform tests of things it's not possible to inline + if (callee->has_exception_handlers() && + !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers"); + if (callee->is_synchronized() && + !InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized"); + if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet"); + if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match"); + + // Proper inlining of methods with jsrs requires a little more work. + if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet"); + + // When SSE2 is used on intel, then no special handling is needed + // for strictfp because the enum-constant is fixed at compile time, + // the check for UseSSE2 is needed here + if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) { + INLINE_BAILOUT("caller and callee have different strict fp requirements"); + } + + if (is_profiling() && !callee->ensure_method_data()) { + INLINE_BAILOUT("mdo allocation failed"); + } + + // now perform tests that are based on flag settings + bool inlinee_by_directive = compilation()->directive()->should_inline(callee); + if (callee->force_inline() || inlinee_by_directive) { + if (inline_level() > MaxForceInlineLevel ) INLINE_BAILOUT("MaxForceInlineLevel"); + if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("recursive inlining too deep"); + + const char* msg = ""; + if (callee->force_inline()) msg = "force inline by annotation"; + if (inlinee_by_directive) msg = "force inline by CompileCommand"; + print_inlining(callee, msg); + } else { + // use heuristic controls on inlining + if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("inlining too deep"); + if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("recursive inlining too deep"); + if (callee->code_size_for_inlining() > max_inline_size() ) INLINE_BAILOUT("callee is too large"); + + // don't inline throwable methods unless the inlining tree is rooted in a throwable class + if (callee->name() == ciSymbol::object_initializer_name() && + callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { + // Throwable constructor call + IRScope* top = scope(); + while (top->caller() != NULL) { + top = top->caller(); + } + if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { + INLINE_BAILOUT("don't inline Throwable constructors"); + } + } + + if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) { + INLINE_BAILOUT("total inlining greater than DesiredMethodLimit"); + } + // printing + print_inlining(callee); + } + + // NOTE: Bailouts from this point on, which occur at the + // GraphBuilder level, do not cause bailout just of the inlining but + // in fact of the entire compilation. + + BlockBegin* orig_block = block(); + + const bool is_invokedynamic = bc == Bytecodes::_invokedynamic; + const bool has_receiver = (bc != Bytecodes::_invokestatic && !is_invokedynamic); + + const int args_base = state()->stack_size() - callee->arg_size(); + assert(args_base >= 0, "stack underflow during inlining"); + + // Insert null check if necessary + Value recv = NULL; + if (has_receiver) { + // note: null check must happen even if first instruction of callee does + // an implicit null check since the callee is in a different scope + // and we must make sure exception handling does the right thing + assert(!callee->is_static(), "callee must not be static"); + assert(callee->arg_size() > 0, "must have at least a receiver"); + recv = state()->stack_at(args_base); + null_check(recv); + } + + if (is_profiling()) { + // Note that we'd collect profile data in this method if we wanted it. + // this may be redundant here... + compilation()->set_would_profile(true); + + if (profile_calls()) { + int start = 0; + Values* obj_args = args_list_for_profiling(callee, start, has_receiver); + if (obj_args != NULL) { + int s = obj_args->max_length(); + // if called through method handle invoke, some arguments may have been popped + for (int i = args_base+start, j = 0; j < obj_args->max_length() && i < state()->stack_size(); ) { + Value v = state()->stack_at_inc(i); + if (v->type()->is_object_kind()) { + obj_args->push(v); + j++; + } + } + check_args_for_profiling(obj_args, s); + } + profile_call(callee, recv, holder_known ? callee->holder() : NULL, obj_args, true); + } + } + + // Introduce a new callee continuation point - if the callee has + // more than one return instruction or the return does not allow + // fall-through of control flow, all return instructions of the + // callee will need to be replaced by Goto's pointing to this + // continuation point. + BlockBegin* cont = block_at(next_bci()); + bool continuation_existed = true; + if (cont == NULL) { + cont = new BlockBegin(next_bci()); + // low number so that continuation gets parsed as early as possible + cont->set_depth_first_number(0); + if (PrintInitialBlockList) { + tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d", + cont->block_id(), cont->bci(), bci()); + } + continuation_existed = false; + } + // Record number of predecessors of continuation block before + // inlining, to detect if inlined method has edges to its + // continuation after inlining. + int continuation_preds = cont->number_of_preds(); + + // Push callee scope + push_scope(callee, cont); + + // the BlockListBuilder for the callee could have bailed out + if (bailed_out()) + return false; + + // Temporarily set up bytecode stream so we can append instructions + // (only using the bci of this stream) + scope_data()->set_stream(scope_data()->parent()->stream()); + + // Pass parameters into callee state: add assignments + // note: this will also ensure that all arguments are computed before being passed + ValueStack* callee_state = state(); + ValueStack* caller_state = state()->caller_state(); + for (int i = args_base; i < caller_state->stack_size(); ) { + const int arg_no = i - args_base; + Value arg = caller_state->stack_at_inc(i); + store_local(callee_state, arg, arg_no); + } + + // Remove args from stack. + // Note that we preserve locals state in case we can use it later + // (see use of pop_scope() below) + caller_state->truncate_stack(args_base); + assert(callee_state->stack_size() == 0, "callee stack must be empty"); + + Value lock = NULL; + BlockBegin* sync_handler = NULL; + + // Inline the locking of the receiver if the callee is synchronized + if (callee->is_synchronized()) { + lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror()))) + : state()->local_at(0); + sync_handler = new BlockBegin(SynchronizationEntryBCI); + inline_sync_entry(lock, sync_handler); + } + + if (compilation()->env()->dtrace_method_probes()) { + Values* args = new Values(1); + args->push(append(new Constant(new MethodConstant(method())))); + append(new RuntimeCall(voidType, "dtrace_method_entry", CAST_FROM_FN_PTR(address, SharedRuntime::dtrace_method_entry), args)); + } + + if (profile_inlined_calls()) { + profile_invocation(callee, copy_state_before_with_bci(SynchronizationEntryBCI)); + } + + BlockBegin* callee_start_block = block_at(0); + if (callee_start_block != NULL) { + assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header"); + Goto* goto_callee = new Goto(callee_start_block, false); + // The state for this goto is in the scope of the callee, so use + // the entry bci for the callee instead of the call site bci. + append_with_bci(goto_callee, 0); + _block->set_end(goto_callee); + callee_start_block->merge(callee_state); + + _last = _block = callee_start_block; + + scope_data()->add_to_work_list(callee_start_block); + } + + // Clear out bytecode stream + scope_data()->set_stream(NULL); + scope_data()->set_ignore_return(ignore_return); + + CompileLog* log = compilation()->log(); + if (log != NULL) log->head("parse method='%d'", log->identify(callee)); + + // Ready to resume parsing in callee (either in the same block we + // were in before or in the callee's start block) + iterate_all_blocks(callee_start_block == NULL); + + if (log != NULL) log->done("parse"); + + // If we bailed out during parsing, return immediately (this is bad news) + if (bailed_out()) + return false; + + // iterate_all_blocks theoretically traverses in random order; in + // practice, we have only traversed the continuation if we are + // inlining into a subroutine + assert(continuation_existed || + !continuation()->is_set(BlockBegin::was_visited_flag), + "continuation should not have been parsed yet if we created it"); + + // At this point we are almost ready to return and resume parsing of + // the caller back in the GraphBuilder. The only thing we want to do + // first is an optimization: during parsing of the callee we + // generated at least one Goto to the continuation block. If we + // generated exactly one, and if the inlined method spanned exactly + // one block (and we didn't have to Goto its entry), then we snip + // off the Goto to the continuation, allowing control to fall + // through back into the caller block and effectively performing + // block merging. This allows load elimination and CSE to take place + // across multiple callee scopes if they are relatively simple, and + // is currently essential to making inlining profitable. + if (num_returns() == 1 + && block() == orig_block + && block() == inline_cleanup_block()) { + _last = inline_cleanup_return_prev(); + _state = inline_cleanup_state(); + } else if (continuation_preds == cont->number_of_preds()) { + // Inlining caused that the instructions after the invoke in the + // caller are not reachable any more. So skip filling this block + // with instructions! + assert(cont == continuation(), ""); + assert(_last && _last->as_BlockEnd(), ""); + _skip_block = true; + } else { + // Resume parsing in continuation block unless it was already parsed. + // Note that if we don't change _last here, iteration in + // iterate_bytecodes_for_block will stop when we return. + if (!continuation()->is_set(BlockBegin::was_visited_flag)) { + // add continuation to work list instead of parsing it immediately + assert(_last && _last->as_BlockEnd(), ""); + scope_data()->parent()->add_to_work_list(continuation()); + _skip_block = true; + } + } + + // Fill the exception handler for synchronized methods with instructions + if (callee->is_synchronized() && sync_handler->state() != NULL) { + fill_sync_handler(lock, sync_handler); + } else { + pop_scope(); + } + + compilation()->notice_inlined_method(callee); + + return true; +} + + +bool GraphBuilder::try_method_handle_inline(ciMethod* callee, bool ignore_return) { + ValueStack* state_before = copy_state_before(); + vmIntrinsics::ID iid = callee->intrinsic_id(); + switch (iid) { + case vmIntrinsics::_invokeBasic: + { + // get MethodHandle receiver + const int args_base = state()->stack_size() - callee->arg_size(); + ValueType* type = state()->stack_at(args_base)->type(); + if (type->is_constant()) { + ciMethod* target = type->as_ObjectType()->constant_value()->as_method_handle()->get_vmtarget(); + // We don't do CHA here so only inline static and statically bindable methods. + if (target->is_static() || target->can_be_statically_bound()) { + if (ciMethod::is_consistent_info(callee, target)) { + Bytecodes::Code bc = target->is_static() ? Bytecodes::_invokestatic : Bytecodes::_invokevirtual; + ignore_return = ignore_return || (callee->return_type()->is_void() && !target->return_type()->is_void()); + if (try_inline(target, /*holder_known*/ true, ignore_return, bc)) { + return true; + } + } else { + print_inlining(target, "signatures mismatch", /*success*/ false); + } + } else { + print_inlining(target, "not static or statically bindable", /*success*/ false); + } + } else { + print_inlining(callee, "receiver not constant", /*success*/ false); + } + } + break; + + case vmIntrinsics::_linkToVirtual: + case vmIntrinsics::_linkToStatic: + case vmIntrinsics::_linkToSpecial: + case vmIntrinsics::_linkToInterface: + { + // pop MemberName argument + const int args_base = state()->stack_size() - callee->arg_size(); + ValueType* type = apop()->type(); + if (type->is_constant()) { + ciMethod* target = type->as_ObjectType()->constant_value()->as_member_name()->get_vmtarget(); + ignore_return = ignore_return || (callee->return_type()->is_void() && !target->return_type()->is_void()); + // If the target is another method handle invoke, try to recursively get + // a better target. + if (target->is_method_handle_intrinsic()) { + if (try_method_handle_inline(target, ignore_return)) { + return true; + } + } else if (!ciMethod::is_consistent_info(callee, target)) { + print_inlining(target, "signatures mismatch", /*success*/ false); + } else { + ciSignature* signature = target->signature(); + const int receiver_skip = target->is_static() ? 0 : 1; + // Cast receiver to its type. + if (!target->is_static()) { + ciKlass* tk = signature->accessing_klass(); + Value obj = state()->stack_at(args_base); + if (obj->exact_type() == NULL && + obj->declared_type() != tk && tk != compilation()->env()->Object_klass()) { + TypeCast* c = new TypeCast(tk, obj, state_before); + append(c); + state()->stack_at_put(args_base, c); + } + } + // Cast reference arguments to its type. + for (int i = 0, j = 0; i < signature->count(); i++) { + ciType* t = signature->type_at(i); + if (t->is_klass()) { + ciKlass* tk = t->as_klass(); + Value obj = state()->stack_at(args_base + receiver_skip + j); + if (obj->exact_type() == NULL && + obj->declared_type() != tk && tk != compilation()->env()->Object_klass()) { + TypeCast* c = new TypeCast(t, obj, state_before); + append(c); + state()->stack_at_put(args_base + receiver_skip + j, c); + } + } + j += t->size(); // long and double take two slots + } + // We don't do CHA here so only inline static and statically bindable methods. + if (target->is_static() || target->can_be_statically_bound()) { + Bytecodes::Code bc = target->is_static() ? Bytecodes::_invokestatic : Bytecodes::_invokevirtual; + if (try_inline(target, /*holder_known*/ true, ignore_return, bc)) { + return true; + } + } else { + print_inlining(target, "not static or statically bindable", /*success*/ false); + } + } + } else { + print_inlining(callee, "MemberName not constant", /*success*/ false); + } + } + break; + + default: + fatal("unexpected intrinsic %d: %s", iid, vmIntrinsics::name_at(iid)); + break; + } + set_state(state_before->copy_for_parsing()); + return false; +} + + +void GraphBuilder::inline_bailout(const char* msg) { + assert(msg != NULL, "inline bailout msg must exist"); + _inline_bailout_msg = msg; +} + + +void GraphBuilder::clear_inline_bailout() { + _inline_bailout_msg = NULL; +} + + +void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) { + ScopeData* data = new ScopeData(NULL); + data->set_scope(scope); + data->set_bci2block(bci2block); + _scope_data = data; + _block = start; +} + + +void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) { + IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false); + scope()->add_callee(callee_scope); + + BlockListBuilder blb(compilation(), callee_scope, -1); + CHECK_BAILOUT(); + + if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) { + // this scope can be inlined directly into the caller so remove + // the block at bci 0. + blb.bci2block()->at_put(0, NULL); + } + + set_state(new ValueStack(callee_scope, state()->copy(ValueStack::CallerState, bci()))); + + ScopeData* data = new ScopeData(scope_data()); + data->set_scope(callee_scope); + data->set_bci2block(blb.bci2block()); + data->set_continuation(continuation); + _scope_data = data; +} + + +void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) { + ScopeData* data = new ScopeData(scope_data()); + data->set_parsing_jsr(); + data->set_jsr_entry_bci(jsr_dest_bci); + data->set_jsr_return_address_local(-1); + // Must clone bci2block list as we will be mutating it in order to + // properly clone all blocks in jsr region as well as exception + // handlers containing rets + BlockList* new_bci2block = new BlockList(bci2block()->length()); + new_bci2block->appendAll(bci2block()); + data->set_bci2block(new_bci2block); + data->set_scope(scope()); + data->setup_jsr_xhandlers(); + data->set_continuation(continuation()); + data->set_jsr_continuation(jsr_continuation); + _scope_data = data; +} + + +void GraphBuilder::pop_scope() { + int number_of_locks = scope()->number_of_locks(); + _scope_data = scope_data()->parent(); + // accumulate minimum number of monitor slots to be reserved + scope()->set_min_number_of_locks(number_of_locks); +} + + +void GraphBuilder::pop_scope_for_jsr() { + _scope_data = scope_data()->parent(); +} + +void GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) { + Values* args = state()->pop_arguments(callee->arg_size()); + null_check(args->at(0)); + Instruction* offset = args->at(2); +#ifndef _LP64 + offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); +#endif + Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile)); + push(op->type(), op); + compilation()->set_has_unsafe_access(true); +} + + +void GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) { + Values* args = state()->pop_arguments(callee->arg_size()); + null_check(args->at(0)); + Instruction* offset = args->at(2); +#ifndef _LP64 + offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); +#endif + Value val = args->at(3); + if (t == T_BOOLEAN) { + Value mask = append(new Constant(new IntConstant(1))); + val = append(new LogicOp(Bytecodes::_iand, val, mask)); + } + Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, val, is_volatile)); + compilation()->set_has_unsafe_access(true); + kill_all(); +} + + +void GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) { + Values* args = state()->pop_arguments(callee->arg_size()); + null_check(args->at(0)); + Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false)); + push(op->type(), op); + compilation()->set_has_unsafe_access(true); +} + + +void GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) { + Values* args = state()->pop_arguments(callee->arg_size()); + null_check(args->at(0)); + Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2))); + compilation()->set_has_unsafe_access(true); +} + + +void GraphBuilder::append_unsafe_CAS(ciMethod* callee) { + ValueStack* state_before = copy_state_for_exception(); + ValueType* result_type = as_ValueType(callee->return_type()); + assert(result_type->is_int(), "int result"); + Values* args = state()->pop_arguments(callee->arg_size()); + + // Pop off some args to specially handle, then push back + Value newval = args->pop(); + Value cmpval = args->pop(); + Value offset = args->pop(); + Value src = args->pop(); + Value unsafe_obj = args->pop(); + + // Separately handle the unsafe arg. It is not needed for code + // generation, but must be null checked + null_check(unsafe_obj); + +#ifndef _LP64 + offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); +#endif + + args->push(src); + args->push(offset); + args->push(cmpval); + args->push(newval); + + // An unsafe CAS can alias with other field accesses, but we don't + // know which ones so mark the state as no preserved. This will + // cause CSE to invalidate memory across it. + bool preserves_state = false; + Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, state_before, preserves_state); + append_split(result); + push(result_type, result); + compilation()->set_has_unsafe_access(true); +} + +void GraphBuilder::append_char_access(ciMethod* callee, bool is_store) { + // This intrinsic accesses byte[] array as char[] array. Computing the offsets + // correctly requires matched array shapes. + assert (arrayOopDesc::base_offset_in_bytes(T_CHAR) == arrayOopDesc::base_offset_in_bytes(T_BYTE), + "sanity: byte[] and char[] bases agree"); + assert (type2aelembytes(T_CHAR) == type2aelembytes(T_BYTE)*2, + "sanity: byte[] and char[] scales agree"); + + ValueStack* state_before = copy_state_indexed_access(); + compilation()->set_has_access_indexed(true); + Values* args = state()->pop_arguments(callee->arg_size()); + Value array = args->at(0); + Value index = args->at(1); + if (is_store) { + Value value = args->at(2); + Instruction* store = append(new StoreIndexed(array, index, NULL, T_CHAR, value, state_before, false, true)); + store->set_flag(Instruction::NeedsRangeCheckFlag, false); + _memory->store_value(value); + } else { + Instruction* load = append(new LoadIndexed(array, index, NULL, T_CHAR, state_before, true)); + load->set_flag(Instruction::NeedsRangeCheckFlag, false); + push(load->type(), load); + } +} + +void GraphBuilder::print_inlining(ciMethod* callee, const char* msg, bool success) { + CompileLog* log = compilation()->log(); + if (log != NULL) { + if (success) { + if (msg != NULL) + log->inline_success(msg); + else + log->inline_success("receiver is statically known"); + } else { + if (msg != NULL) + log->inline_fail(msg); + else + log->inline_fail("reason unknown"); + } + } +#if INCLUDE_TRACE + EventCompilerInlining event; + if (event.should_commit()) { + event.set_compileId(compilation()->env()->task()->compile_id()); + event.set_message(msg); + event.set_succeeded(success); + event.set_bci(bci()); + event.set_caller(method()->get_Method()); + event.set_callee(callee->to_trace_struct()); + event.commit(); + } +#endif // INCLUDE_TRACE + + CompileTask::print_inlining_ul(callee, scope()->level(), bci(), msg); + + if (!compilation()->directive()->PrintInliningOption) { + return; + } + CompileTask::print_inlining_tty(callee, scope()->level(), bci(), msg); + if (success && CIPrintMethodCodes) { + callee->print_codes(); + } +} + +void GraphBuilder::append_unsafe_get_and_set_obj(ciMethod* callee, bool is_add) { + Values* args = state()->pop_arguments(callee->arg_size()); + BasicType t = callee->return_type()->basic_type(); + null_check(args->at(0)); + Instruction* offset = args->at(2); +#ifndef _LP64 + offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); +#endif + Instruction* op = append(new UnsafeGetAndSetObject(t, args->at(1), offset, args->at(3), is_add)); + compilation()->set_has_unsafe_access(true); + kill_all(); + push(op->type(), op); +} + +#ifndef PRODUCT +void GraphBuilder::print_stats() { + vmap()->print(); +} +#endif // PRODUCT + +void GraphBuilder::profile_call(ciMethod* callee, Value recv, ciKlass* known_holder, Values* obj_args, bool inlined) { + assert(known_holder == NULL || (known_holder->is_instance_klass() && + (!known_holder->is_interface() || + ((ciInstanceKlass*)known_holder)->has_nonstatic_concrete_methods())), "should be non-static concrete method"); + if (known_holder != NULL) { + if (known_holder->exact_klass() == NULL) { + known_holder = compilation()->cha_exact_type(known_holder); + } + } + + append(new ProfileCall(method(), bci(), callee, recv, known_holder, obj_args, inlined)); +} + +void GraphBuilder::profile_return_type(Value ret, ciMethod* callee, ciMethod* m, int invoke_bci) { + assert((m == NULL) == (invoke_bci < 0), "invalid method and invalid bci together"); + if (m == NULL) { + m = method(); + } + if (invoke_bci < 0) { + invoke_bci = bci(); + } + ciMethodData* md = m->method_data_or_null(); + ciProfileData* data = md->bci_to_data(invoke_bci); + if (data != NULL && (data->is_CallTypeData() || data->is_VirtualCallTypeData())) { + bool has_return = data->is_CallTypeData() ? ((ciCallTypeData*)data)->has_return() : ((ciVirtualCallTypeData*)data)->has_return(); + if (has_return) { + append(new ProfileReturnType(m , invoke_bci, callee, ret)); + } + } +} + +void GraphBuilder::profile_invocation(ciMethod* callee, ValueStack* state) { + append(new ProfileInvoke(callee, state)); +}